Link to this page
Human Interaction Network Ontology
Last uploaded:
June 27, 2014
Jump to:
| Preferred Name | aspartic acid | |
| Synonyms |
InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9) DL-Asparagic acid (+-)-Aspartic acid C4H7NO4 2-aminobutanedioic acid InChIKey=CKLJMWTZIZZHCS-UHFFFAOYSA-N (R,S)-Aspartic acid NC(CC(O)=O)C(O)=O DL-Aminosuccinic acid Asp D aspartic acid |
|
| Definitions |
An alpha-amino acid that consists of succinic acid bearing a single alpha-amino substituent |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_22660 |
|
| database_cross_reference |
Reaxys:774618 Gmelin:185140 Beilstein:774618 CiteXplore:22264337 Wikipedia:Aspartic_acid ChemIDplus:617-45-8 NIST Chemistry WebBook:617-45-8 KEGG COMPOUND:C16433
|
|
| definition |
An alpha-amino acid that consists of succinic acid bearing a single alpha-amino substituent
|
|
| has_exact_synonym |
aspartic acid
|
|
| has_obo_namespace |
chebi_ontology
|
|
| has_related_synonym |
InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9) DL-Asparagic acid (+-)-Aspartic acid C4H7NO4 2-aminobutanedioic acid InChIKey=CKLJMWTZIZZHCS-UHFFFAOYSA-N (R,S)-Aspartic acid NC(CC(O)=O)C(O)=O DL-Aminosuccinic acid Asp D
|
|
| id |
CHEBI:22660
|
|
| imported from | ||
| label |
aspartic acid
|
|
| notation |
CHEBI:22660
|
|
| prefLabel |
aspartic acid
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping