loading...| Preferred Name |
L-isoleucine |
|
| Synonyms |
C6H13NO2 (2S,3S)-2-amino-3-methylpentanoic acid Ile CC[C@H](C)[C@H](N)C(O)=O alpha-amino-beta-methylvaleric acid 2-Amino-3-methylvaleric acid ISOLEUCINE InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1 InChIKey=AGPKZVBTJJNPAG-WHFBIAKZSA-N I L-Isoleucine L-isoleucine |
|
| Definitions |
The L-enantiomer of isoleucine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17191 |
|
| database_cross_reference |
Gmelin:486381 CiteXplore:17299083 CiteXplore:16140883 CiteXplore:14651987 Beilstein:1721792 CiteXplore:17409434 Reaxys:1721792 ChemIDplus:73-32-5 NIST Chemistry WebBook:73-32-5 KEGG COMPOUND:C00407 PDBeChem:ILE DrugBank:DB00167 CiteXplore:22298573 KEGG COMPOUND:73-32-5 |
|
| definition |
The L-enantiomer of isoleucine. |
|
| has_alternative_id |
CHEBI:43342 CHEBI:13127 CHEBI:43290 CHEBI:43366 CHEBI:6255 CHEBI:21344 |
|
| has_exact_synonym |
L-Isoleucine L-isoleucine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
C6H13NO2 (2S,3S)-2-amino-3-methylpentanoic acid Ile CC[C@H](C)[C@H](N)C(O)=O alpha-amino-beta-methylvaleric acid 2-Amino-3-methylvaleric acid ISOLEUCINE InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1 InChIKey=AGPKZVBTJJNPAG-WHFBIAKZSA-N I |
|
| id |
CHEBI:17191 |
|
| imported from | ||
| label |
L-isoleucine |
|
| notation |
CHEBI:17191 |
|
| prefixIRI |
CHEBI:17191 |
|
| prefLabel |
L-isoleucine |
|
| subClassOf |