Link to this page
Human Interaction Network Ontology
Last uploaded:
June 27, 2014
Jump to:
| Preferred Name | 2-amino-3-methylpentanoic acid | |
| Synonyms |
C6H13NO2 InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) InChIKey=AGPKZVBTJJNPAG-UHFFFAOYSA-N CCC(C)C(N)C(O)=O 2-amino-3-methylpentanoic acid |
|
| Definitions |
A branched chain amino acid that consists of 3-methylpentanoic acid bearing an amino substituent at position 2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_38264 |
|
| database_cross_reference |
Reaxys:1721790
|
|
| definition |
A branched chain amino acid that consists of 3-methylpentanoic acid bearing an amino substituent at position 2.
|
|
| has_exact_synonym |
2-amino-3-methylpentanoic acid
|
|
| has_obo_namespace |
chebi_ontology
|
|
| has_related_synonym |
C6H13NO2 InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) InChIKey=AGPKZVBTJJNPAG-UHFFFAOYSA-N CCC(C)C(N)C(O)=O
|
|
| id |
CHEBI:38264
|
|
| imported from | ||
| label |
2-amino-3-methylpentanoic acid
|
|
| notation |
CHEBI:38264
|
|
| prefLabel |
2-amino-3-methylpentanoic acid
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping