loading...| Preferred Name | ubiquinones | |
| Synonyms |
InChIKey=SOECUQMRSRVZQQ-UHFFFAOYSA-N a ubiquinone Coenzyme Q Q coenzyme Q mitochondrial ubiquinone C9H10O4(C5H8)n InChI=1S/C14H18O4/c1-8(2)6-7-10-9(3)11(15)13(17-4)14(18-5)12(10)16/h6H,7H2,1-5H3 coenzymes Q Koenzym Q Coenzym Q CoQ Ubichinon mitoquinones mitochondrial ubiquinones Ubiquinone Ubiquinones |
|
| Definitions |
Any benzoquinone derived from 2,3-dimethoxy-5-methylbenzoquinone; one of a group of naturally occurring homologues. The redox-active quinoid moiety usually carries a polyprenoid side chain at position 6, the number of isoprenoid units in which is species-specific. Ubiquinones are involved in the control of mitochondrial electron transport, and are also potent anti-oxidants. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16389 |
|
| database_cross_reference |
ChemIDplus:1339-63-5 CiteXplore:7599208 KEGG COMPOUND:1339-63-5 CiteXplore:15788391 KEGG COMPOUND:C00399 |
|
| definition |
Any benzoquinone derived from 2,3-dimethoxy-5-methylbenzoquinone; one of a group of naturally occurring homologues. The redox-active quinoid moiety usually carries a polyprenoid side chain at position 6, the number of isoprenoid units in which is species-specific. Ubiquinones are involved in the control of mitochondrial electron transport, and are also potent anti-oxidants. |
|
| has_alternative_id |
CHEBI:27186 CHEBI:15279 CHEBI:9852 |
|
| has_exact_synonym |
Ubiquinones |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
InChIKey=SOECUQMRSRVZQQ-UHFFFAOYSA-N a ubiquinone Coenzyme Q Q coenzyme Q mitochondrial ubiquinone C9H10O4(C5H8)n InChI=1S/C14H18O4/c1-8(2)6-7-10-9(3)11(15)13(17-4)14(18-5)12(10)16/h6H,7H2,1-5H3 coenzymes Q Koenzym Q Coenzym Q CoQ Ubichinon mitoquinones mitochondrial ubiquinones Ubiquinone |
|
| id |
CHEBI:16389 |
|
| imported from | ||
| label |
ubiquinones |
|
| notation |
CHEBI:16389 |
|
| prefixIRI |
CHEBI:16389 |
|
| prefLabel |
ubiquinones |
|
| subClassOf |