Preferred Name |
menadione |
|
Synonyms |
2-methylnaphthalene-1,4-dione MENADIONE Menadione menadione 2-Methyl-1,4-naphthochinon menaphthone 2-methylnaphthoquinone menaquinone menaquinone 0 3-methyl-1,4-naphthoquinone 2-methyl-1,4-naphthoquinone 2-methyl-1,4-naphthalenedione Aquakay Aquinone Hemodal Kappaxin menadion menaphthon vitamin K3 |
|
Definitions |
A member of the class of 1,4-naphthoquinones that is 1,4-naphthoquinone which is substituted at position 2 by a methyl group. It is used as a nutritional supplement and for the treatment of hypoprothrombinemia. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28869 |
|
charge |
0 |
|
database_cross_reference |
PMID:30119016 PMID:33901557 KEGG:D02335 PMID:31238027 PMID:15722567 PMID:31520616 PMID:2333843 PMID:9010592 PMID:10433694 PMID:15613473 MetaCyc:CPD-3766 Reaxys:1908453 PMID:1650428 HMDB:HMDB0001892 Wikipedia:Menadione PMID:2064595 PMID:33800926 PMID:8785182 PMID:9380028 PMID:1857739 LINCS:LSM-3755 PMID:1697141 PMID:19593550 PMID:33945810 PMID:11372776 KEGG:C05377 PMID:19766112 PMID:33227312 PMID:16109308 PMID:31701430 PMID:32798378 PMID:15265851 PMID:18698499 PMID:12665684 PMID:12895502 PMID:34040527 PMID:15052609 CAS:58-27-5 FooDB:FDB000953 PMID:16140270 PDBeChem:VK3 PMID:3083821 PMID:28166217 Drug_Central:1683 PMID:30609653 PMID:13779073 DrugBank:DB00170 PMID:32630491 PMID:16469140 Chemspider:3915 |
|
definition |
A member of the class of 1,4-naphthoquinones that is 1,4-naphthoquinone which is substituted at position 2 by a methyl group. It is used as a nutritional supplement and for the treatment of hypoprothrombinemia. |
|
formula |
C11H8O2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_147285 http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_84087 |
|
has_alternative_id |
CHEBI:46306 CHEBI:27304 CHEBI:6747 |
|
has_exact_synonym |
2-methylnaphthalene-1,4-dione MENADIONE Menadione menadione |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-Methyl-1,4-naphthochinon menaphthone 2-methylnaphthoquinone menaquinone menaquinone 0 3-methyl-1,4-naphthoquinone 2-methyl-1,4-naphthoquinone 2-methyl-1,4-naphthalenedione Aquakay Aquinone Hemodal Kappaxin menadion menaphthon vitamin K3 |
|
id |
CHEBI:28869 |
|
in_subset | ||
inchi |
InChI=1S/C11H8O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6H,1H3 |
|
inchikey |
MJVAVZPDRWSRRC-UHFFFAOYSA-N |
|
label |
menadione |
|
mass |
172.183 |
|
monoisotopicmass |
172.05243 |
|
notation |
CHEBI:28869 |
|
prefLabel |
menadione |
|
smiles |
CC1=CC(=O)C2=C(C=CC=C2)C1=O |
|
subClassOf |