Jump to:
loading...| Preferred Name | valine | |
| Synonyms |
2-amino-3-methylbutanoic acid DL-valine Hval Valin valina valine |
|
| Definitions |
A branched-chain amino acid that consists of glycine in which one of the hydrogens attached to the alpha-carbon is substituted by an isopropyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27266 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Valine CAS:516-06-3 Gmelin:49877 KEGG:C16436 PMID:17190852 Beilstein:506689 PMID:22770225 Reaxys:506689 |
|
| definition |
A branched-chain amino acid that consists of glycine in which one of the hydrogens attached to the alpha-carbon is substituted by an isopropyl group. |
|
| formula |
C5H11NO2 |
|
| has characteristic | ||
| has part | ||
| has role | ||
| has_exact_synonym |
valine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-amino-3-methylbutanoic acid DL-valine Hval Valin valina |
|
| id |
CHEBI:27266 |
|
| in_subset | ||
| inchi |
InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8) |
|
| inchikey |
KZSNJWFQEVHDMF-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| label |
valine |
|
| mass |
117.14638 |
|
| monoisotopicmass |
117.07898 |
|
| notation |
CHEBI:27266 |
|
| prefLabel |
valine |
|
| smiles |
CC(C)C(N)C(O)=O |
|
| subClassOf |
Create mapping