Preferred Name |
lamotrigine |
|
Synonyms |
3,5-diamino-6-(2,3-dichlorophenyl)-1,2,4-triazine Lamictal lamotrigine lamotriginum lamotrigina 6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine |
|
Definitions |
A member of the class of 1,2,4-triazines in which the triazene skeleton is substituted by amino groups at positions 3 and 5, and by a 2,3-dichlorophenyl group at position 6. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6367 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Lamotrigine LINCS:LSM-4104 PMID:19430925 KEGG:D00354 PMID:20825390 PMID:21242744 HMDB:HMDB0014695 CAS:84057-84-1 Reaxys:7589268 Drug_Central:1540 DrugBank:DB00555 |
|
definition |
A member of the class of 1,2,4-triazines in which the triazene skeleton is substituted by amino groups at positions 3 and 5, and by a 2,3-dichlorophenyl group at position 6. |
|
formula |
C9H7Cl2N5 |
|
has_exact_synonym |
6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
3,5-diamino-6-(2,3-dichlorophenyl)-1,2,4-triazine Lamictal lamotrigine lamotriginum lamotrigina |
|
id |
CHEBI:6367 |
|
in_subset | ||
inchi |
InChI=1S/C9H7Cl2N5/c10-5-3-1-2-4(6(5)11)7-8(12)14-9(13)16-15-7/h1-3H,(H4,12,13,14,16) |
|
inchikey |
PYZRQGJRPPTADH-UHFFFAOYSA-N |
|
label |
lamotrigine |
|
mass |
256.09100 |
|
monoisotopicmass |
255.00785 |
|
notation |
CHEBI:6367 |
|
preferred label |
lamotrigine |
|
prefLabel |
lamotrigine |
|
smiles |
Nc1nnc(c(N)n1)-c1cccc(Cl)c1Cl |
|
subClassOf |