loading...| Preferred Name | methamphetamine | |
| Synonyms |
d-N-methylamphetamine dextromethamphetamine d-deoxyephedrine d-1-phenyl-2-methylaminopropane metamfetaminum d-phenylisopropylmethylamine metanfetamina (S)-N,alpha-dimethylbenzeneethanamine metamfetamine d-desoxyephedrine (+)-(S)-N-alpha-dimethylphenethylamine (alphaS)-N,alpha-dimethylbenzeneethanamine methyl-beta-phenylisopropylamine Methamphetamine (2S)-N-methyl-1-phenylpropan-2-amine |
|
| Definitions |
A member of the class of amphetamines in which the amino group of (S)-amphetamine carries a methyl substituent. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6809 |
|
| bearer of |
http://purl.obolibrary.org/obo/CHEBI_35471 http://purl.obolibrary.org/obo/CHEBI_35703 |
|
| charge |
0 |
|
| formula |
C10H15N |
|
| has exact synonym |
Methamphetamine (2S)-N-methyl-1-phenylpropan-2-amine |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35471 http://purl.obolibrary.org/obo/CHEBI_35703 |
|
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
d-N-methylamphetamine dextromethamphetamine d-deoxyephedrine d-1-phenyl-2-methylaminopropane metamfetaminum d-phenylisopropylmethylamine metanfetamina (S)-N,alpha-dimethylbenzeneethanamine metamfetamine d-desoxyephedrine (+)-(S)-N-alpha-dimethylphenethylamine (alphaS)-N,alpha-dimethylbenzeneethanamine methyl-beta-phenylisopropylamine |
|
| id |
CHEBI:6809 |
|
| inchi |
InChI=1S/C10H15N/c1-9(11-2)8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3/t9-/m0/s1 |
|
| inchikey |
MYWUZJCMWCOHBA-VIFPVBQESA-N |
|
| inSubset | ||
| is conjugate base of | ||
| label |
methamphetamine |
|
| mass |
149.23284 |
|
| monoisotopicmass |
149.12045 |
|
| notation |
CHEBI:6809 |
|
| prefLabel |
methamphetamine |
|
| smiles |
CN[C@@H](C)Cc1ccccc1 |
|
| textual definition |
A member of the class of amphetamines in which the amino group of (S)-amphetamine carries a methyl substituent. |
|
| xRef |
PMID:26541330 PMID:11717374 PMID:26568405 PMID:19732271 Wikipedia:Methamphetamine PMID:11896153 PMID:18509037 PMID:19269222 PMID:24349338 PMID:11831503 PMID:15380623 PMID:11847428 DrugBank:DB01577 PMID:25724762 HMDB:HMDB0015517 PMID:14769818 KEGG:C07164 Drug_Central:1732 PMID:11711870 PMID:27232669 PMID:19576287 PMID:14645148 PMID:15808793 PMID:11829406 PMID:18521756 PMID:15542728 PMID:15542724 CAS:537-46-2 PMID:26683901 Reaxys:2207147 PMID:26992824 PMID:11406298 PMID:26302754 PMID:26775284 KEGG:D08187 PMID:11984857 PMID:18279499 PMID:19384581 Beilstein:2207147 PMID:18991862 PMID:18991860 PMID:11221576 PDBeChem:B40 |
|
| subClassOf |