loading...| Preferred Name | benzophenone | |
| Synonyms |
alpha-oxoditane Diphenyl ketone benzoylbenzene DIPHENYLMETHANONE alpha-oxodiphenylmethane Ph2CO benzophenone diphenylmethanone Benzophenone |
|
| Definitions |
The simplest member of the class of benzophenones, being formaldehyde in which both hydrogens are replaced by phenyl groups. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_41308 |
|
| bearer of | ||
| charge |
0 |
|
| formula |
C13H10O |
|
| has exact synonym |
benzophenone diphenylmethanone Benzophenone |
|
| has role | ||
| hasAlternativeId |
CHEBI:41306 CHEBI:3034 |
|
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
alpha-oxoditane Diphenyl ketone benzoylbenzene DIPHENYLMETHANONE alpha-oxodiphenylmethane Ph2CO |
|
| id |
CHEBI:41308 |
|
| inchi |
InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
|
| inchikey |
RWCCWEUUXYIKHB-UHFFFAOYSA-N |
|
| inSubset | ||
| label |
benzophenone |
|
| mass |
182.222 |
|
| monoisotopicmass |
182.07316 |
|
| notation |
CHEBI:41308 |
|
| prefLabel |
benzophenone |
|
| smiles |
O=C(C1=CC=CC=C1)C1=CC=CC=C1 |
|
| textual definition |
The simplest member of the class of benzophenones, being formaldehyde in which both hydrogens are replaced by phenyl groups. |
|
| xRef |
PMID:17955805 Beilstein:1238185 PMID:15672204 PMID:19939518 PMID:16212356 PMID:21277784 PMID:10728861 KEGG:C06354 PMID:16820853 PMID:16853025 PMID:33682414 PMID:19655709 DrugBank:DB01878 PMID:30720459 Gmelin:4256 PMID:24226914 PMID:17439666 PMID:21238557 PMID:14673848 PMID:10864504 PMID:26254646 PMID:20534002 PMID:23963450 PMID:26282042 Reaxys:1238185 PMID:25788150 Chemspider:2991 HMDB:HMDB0032049 Wikipedia:Benzophenone CAS:119-61-9 PMID:21919502 PMID:19388040 PMID:15373829 PDBeChem:BZQ PMID:10877357 PMID:16999485 PMID:32736220 |
|
| subClassOf |