Jump to:
loading...| Preferred Name | acrylate | |
| Synonyms |
2-propenoic acid, ion(1-) 2-propenoate Propenoate prop-2-enoate acrylate |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_37080 |
|
| bearer of | ||
| charge |
-1 |
|
| formula |
C3H3O2 |
|
| has exact synonym |
prop-2-enoate acrylate |
|
| has role | ||
| hasAlternativeId |
CHEBI:35937 CHEBI:13721 |
|
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
2-propenoic acid, ion(1-) 2-propenoate Propenoate |
|
| id |
CHEBI:37080 |
|
| inchi |
InChI=1S/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5)/p-1 |
|
| inchikey |
NIXOWILDQLNWCW-UHFFFAOYSA-M |
|
| inSubset | ||
| is conjugate base of | ||
| label |
acrylate |
|
| mass |
71.05472 |
|
| monoisotopicmass |
71.01385 |
|
| notation |
CHEBI:37080 |
|
| prefLabel |
acrylate |
|
| smiles |
[O-]C(=O)C=C |
|
| xRef |
Beilstein:3931336 UM-BBD_compID:c0113 Beilstein:3535778 Gmelin:323518 CAS:10344-93-1 KEGG:C00511 |
|
| subClassOf |
Create mapping