loading...| Preferred Name | methamphetamine hydrochloride | |
| Synonyms |
methamphetaminium chloride (+)-methamphetamine hydrochloride (S)-(+)-methamphetamine hydrochloride (+)-N,alpha-dimethylphenethylamine hydrochloride methamphetamine hydrogen chloride d-methaphetamine hydrochloride methamphetamine hydrochloride (2S)-N-methyl-1-phenylpropan-2-amine hydrochloride |
|
| Definitions |
A hydrochloride having methamphetamine as the base component. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_35340 |
|
| charge |
0 |
|
| formula |
C10H16ClN |
|
| has exact synonym |
methamphetamine hydrochloride (2S)-N-methyl-1-phenylpropan-2-amine hydrochloride |
|
| has part | ||
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
methamphetaminium chloride (+)-methamphetamine hydrochloride (S)-(+)-methamphetamine hydrochloride (+)-N,alpha-dimethylphenethylamine hydrochloride methamphetamine hydrogen chloride d-methaphetamine hydrochloride |
|
| id |
CHEBI:35340 |
|
| inchi |
InChI=1S/C10H15N.ClH/c1-9(11-2)8-10-6-4-3-5-7-10;/h3-7,9,11H,8H2,1-2H3;1H/t9-;/m0./s1 |
|
| inchikey |
TWXDDNPPQUTEOV-FVGYRXGTSA-N |
|
| inSubset | ||
| label |
methamphetamine hydrochloride |
|
| mass |
185.69400 |
|
| monoisotopicmass |
185.09713 |
|
| notation |
CHEBI:35340 |
|
| overlaps | ||
| prefLabel |
methamphetamine hydrochloride |
|
| smiles |
Cl.CN[C@@H](C)Cc1ccccc1 |
|
| textual definition |
A hydrochloride having methamphetamine as the base component. |
|
| xRef |
Beilstein:5125268 Reaxys:5125268 CAS:51-57-0 |
|
| subClassOf |