loading...| Preferred Name | adrenaline | |
| Synonyms |
racepinefrinum (+-)-adrenaline dl-adrenaline racepinefrina racepinefrine epinephrine racemic 2-(methylamino)-1-(3,4-dihydroxyphenyl)ethanol (+-)-epinephrine 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
|
| Definitions |
A catecholamine in which the aminoethyl side-chain is hydroxy-substituted at C-1 and methylated on nitrogen. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_33568 |
|
| bearer of | ||
| charge |
0 |
|
| formula |
C9H13NO3 |
|
| has exact synonym |
4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
|
| has role | ||
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
racepinefrinum (+-)-adrenaline dl-adrenaline racepinefrina racepinefrine epinephrine racemic 2-(methylamino)-1-(3,4-dihydroxyphenyl)ethanol (+-)-epinephrine |
|
| id |
CHEBI:33568 |
|
| inchi |
InChI=1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3 |
|
| inchikey |
UCTWMZQNUQWSLP-UHFFFAOYSA-N |
|
| inSubset | ||
| label |
adrenaline |
|
| mass |
183.20446 |
|
| monoisotopicmass |
183.08954 |
|
| notation |
CHEBI:33568 |
|
| prefLabel |
adrenaline |
|
| smiles |
CNCC(O)c1ccc(O)c(O)c1 |
|
| textual definition |
A catecholamine in which the aminoethyl side-chain is hydroxy-substituted at C-1 and methylated on nitrogen. |
|
| xRef |
PMID:24719616 LINCS:LSM-4958 CAS:329-65-7 Drug_Central:4508 PMID:10052027 Gmelin:51559 Reaxys:2212160 Beilstein:2212160 PMID:24252294 |
|
| subClassOf |