Jump to:
loading...| Preferred Name | lysine | |
| Synonyms |
alpha,epsilon-diaminocaproic acid K LYS Lysin 2,6-diaminohexanoic acid lysine |
|
| Definitions |
A diamino acid that is caproic (hexanoic) acid bearing two amino substituents at positions 2 and 6. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_25094 |
|
| bearer of | ||
| charge |
0 |
|
| formula |
C6H14N2O2 |
|
| has exact synonym |
2,6-diaminohexanoic acid lysine |
|
| has functional parent | ||
| has part | ||
| has role | ||
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
alpha,epsilon-diaminocaproic acid K LYS Lysin |
|
| id |
CHEBI:25094 |
|
| inchi |
InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10) |
|
| inchikey |
KDXKERNSBIXSRK-UHFFFAOYSA-N |
|
| inSubset | ||
| is conjugate acid of | ||
| is conjugate base of | ||
| label |
lysine |
|
| mass |
146.18764 |
|
| monoisotopicmass |
146.10553 |
|
| notation |
CHEBI:25094 |
|
| overlaps | ||
| prefLabel |
lysine |
|
| smiles |
NCCCCC(N)C(O)=O |
|
| textual definition |
A diamino acid that is caproic (hexanoic) acid bearing two amino substituents at positions 2 and 6. |
|
| xRef |
Gmelin:279284 Wikipedia:Lysine CAS:70-54-2 KEGG:C16440 PMID:17439666 Reaxys:1616991 Beilstein:1616991 PMID:22264337 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33704 |
Create mapping