loading...| Preferred Name | trimethylamine | |
| Synonyms |
N,N-Dimethylmethanamine N,N,N-trimethylamine tridimethylaminomethane Trimethylamin (CH3)3N N(CH3)3 NMe3 TMA N,N-dimethylmethanamine Trimethylamine |
|
| Definitions |
A tertiary amine that is ammonia in which each hydrogen atom is substituted by an methyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18139 |
|
| bearer of | ||
| charge |
0 |
|
| formula |
C3H9N |
|
| has exact synonym |
N,N-dimethylmethanamine Trimethylamine |
|
| has role | ||
| hasAlternativeId |
CHEBI:15261 CHEBI:27127 CHEBI:27125 CHEBI:9732 |
|
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
N,N-Dimethylmethanamine N,N,N-trimethylamine tridimethylaminomethane Trimethylamin (CH3)3N N(CH3)3 NMe3 TMA |
|
| id |
CHEBI:18139 |
|
| inchi |
InChI=1S/C3H9N/c1-4(2)3/h1-3H3 |
|
| inchikey |
GETQZCLCWQTVFV-UHFFFAOYSA-N |
|
| inSubset | ||
| is conjugate base of | ||
| label |
trimethylamine |
|
| mass |
59.11030 |
|
| monoisotopicmass |
59.07350 |
|
| notation |
CHEBI:18139 |
|
| prefLabel |
trimethylamine |
|
| smiles |
CN(C)C |
|
| textual definition |
A tertiary amine that is ammonia in which each hydrogen atom is substituted by an methyl group. |
|
| xRef |
Reaxys:956566 PMID:14047118 Beilstein:956566 Gmelin:1309 PDBeChem:KEN MetaCyc:TRIMETHYLAMINE PMID:15304308 HMDB:HMDB0000906 PMID:1801314 PMID:17190852 PMID:24591617 CAS:75-50-3 PMID:2501587 PMID:5161463 KEGG:C00565 PMID:15752091 Wikipedia:Trimethylamine KNApSAcK:C00001433 |
|
| subClassOf |