loading...| Preferred Name | quinoline | |
| Synonyms |
benzo[b]pyridine Chinolin Quinoline quinoline |
|
| Definitions |
The simplest member of the quinoline class of compounds, comprising a benzene ring ortho fused to C-2 and C-3 of a pyridine ring. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17362 |
|
| charge |
0 |
|
| formula |
C9H7N |
|
| has exact synonym |
Quinoline quinoline |
|
| hasAlternativeId |
CHEBI:15007 CHEBI:8727 |
|
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
benzo[b]pyridine Chinolin |
|
| id |
CHEBI:17362 |
|
| inchi |
InChI=1S/C9H7N/c1-2-6-9-8(4-1)5-3-7-10-9/h1-7H |
|
| inchikey |
SMWDFEZZVXVKRB-UHFFFAOYSA-N |
|
| inSubset | ||
| label |
quinoline |
|
| mass |
129.15860 |
|
| monoisotopicmass |
129.05785 |
|
| notation |
CHEBI:17362 |
|
| prefLabel |
quinoline |
|
| smiles |
c1ccc2ncccc2c1 |
|
| textual definition |
The simplest member of the quinoline class of compounds, comprising a benzene ring ortho fused to C-2 and C-3 of a pyridine ring. |
|
| xRef |
Beilstein:107477 HMDB:HMDB0033731 CAS:91-22-5 Reaxys:107477 KNApSAcK:C00026478 MetaCyc:QUINOLINE PMID:8070089 KEGG:C06413 PMID:16406213 Wikipedia:Quinoline Gmelin:27201 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50893 http://purl.obolibrary.org/obo/CHEBI_26513 |