loading...| Preferred Name | beta-alanine | |
| Synonyms |
3-Aminopropionic acid 3-aminopropanoic acid omega-aminopropionic acid H-beta-Ala-OH beta-aminopropionic acid bAla beta-Alanine BETA-ALANINE beta-alanine |
|
| Definitions |
A naturally-occurring beta-amino acid comprising propionic acid with the amino group in the 3-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16958 |
|
| bearer of |
http://purl.obolibrary.org/obo/CHEBI_25512 http://purl.obolibrary.org/obo/CHEBI_48705 http://purl.obolibrary.org/obo/CHEBI_77746 |
|
| charge |
0 |
|
| formula |
C3H7NO2 |
|
| has exact synonym |
beta-Alanine BETA-ALANINE 3-aminopropanoic acid beta-alanine |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_25512 http://purl.obolibrary.org/obo/CHEBI_48705 http://purl.obolibrary.org/obo/CHEBI_77746 |
|
| hasAlternativeId |
CHEBI:10343 CHEBI:12389 CHEBI:41050 CHEBI:22821 |
|
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
3-Aminopropionic acid 3-aminopropanoic acid omega-aminopropionic acid H-beta-Ala-OH beta-aminopropionic acid bAla |
|
| id |
CHEBI:16958 |
|
| inchi |
InChI=1S/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6) |
|
| inchikey |
UCMIRNVEIXFBKS-UHFFFAOYSA-N |
|
| inSubset | ||
| is conjugate acid of | ||
| is_tautomer_of | ||
| label |
beta-alanine |
|
| mass |
89.09322 |
|
| monoisotopicmass |
89.04768 |
|
| notation |
CHEBI:16958 |
|
| prefLabel |
beta-alanine |
|
| smiles |
NCCC(O)=O |
|
| textual definition |
A naturally-occurring beta-amino acid comprising propionic acid with the amino group in the 3-position. |
|
| xRef |
PMID:20994958 Reaxys:906793 DrugBank:DB03107 Beilstein:906793 PMID:19955842 PMID:12887142 PMID:19239140 MetaCyc:B-ALANINE PMID:14363188 HMDB:HMDB0000056 PMID:11850512 PMID:18613640 CAS:107-95-9 PMID:16934791 Wikipedia:Beta-Alanine Gmelin:49614 PMID:11139233 PMID:22735334 PMID:20479615 PMID:20386120 KEGG:C00099 PDBeChem:BAL PMID:12107759 KNApSAcK:C00001333 KEGG:D07561 PMID:20199122 PMID:18528519 |
|
| subClassOf |