loading...| Preferred Name | probucol | |
| Synonyms |
Acetone bis(3,5-di-tert-butyl-4-hydroxyphenyl) mercaptole 4,4'- (Isopropylidenedithio)bis(2,6-di-tert-butylphenol) Bisphenabid Biphenabid Bisbid DH-581 Lesterol Lorelco Lurselle Serterol Superlipid probucol probucolum 4,4'-(propane-2,2-diyldisulfanediyl)bis(2,6-di-tert-butylphenol) |
|
| Definitions |
A dithioketal that is propane-2,2-dithiol in which the hydrogens attached to both sulfur atoms are replaced by 3,5-di-tert-butyl-4-hydroxyphenyl groups. An anticholesteremic drug with antioxidant and anti-inflammatory properties, it is used to treat high levels of cholesterol in blood. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8427 |
|
| alternative label |
Acetone bis(3,5-di-tert-butyl-4-hydroxyphenyl) mercaptole 4,4'- (Isopropylidenedithio)bis(2,6-di-tert-butylphenol) Bisphenabid Biphenabid Bisbid DH-581 Lesterol Lorelco Lurselle Serterol Superlipid probucol probucolum 4,4'-(propane-2,2-diyldisulfanediyl)bis(2,6-di-tert-butylphenol) |
|
| charge |
0 |
|
| database_cross_reference |
PMID:23107872 PMID:23443157 Patent:US3576883 CAS:23288-49-5 Patent:CN102973535 KEGG:D00476 Patent:CN101423484 Patent:CN101455842 Reaxys:2026253 PMID:23378294 Patent:US3862332 Patent:FR1561853 HMDB:HMDB0015537 PMID:23334712 PMID:22305809 PMID:23363981 DrugBank:DB01599 PMID:23741215 LINCS:LSM-3617 PMID:23167559 Wikipedia:Probucol Drug_Central:2269 KEGG:C07373 |
|
| definition |
A dithioketal that is propane-2,2-dithiol in which the hydrogens attached to both sulfur atoms are replaced by 3,5-di-tert-butyl-4-hydroxyphenyl groups. An anticholesteremic drug with antioxidant and anti-inflammatory properties, it is used to treat high levels of cholesterol in blood. |
|
| formula |
C31H48O2S2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_22586 http://purl.obolibrary.org/obo/CHEBI_35821 |
|
| has_exact_synonym |
4,4'-(propane-2,2-diyldisulfanediyl)bis(2,6-di-tert-butylphenol) |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Acetone bis(3,5-di-tert-butyl-4-hydroxyphenyl) mercaptole 4,4'- (Isopropylidenedithio)bis(2,6-di-tert-butylphenol) Bisphenabid Biphenabid Bisbid DH-581 Lesterol Lorelco Lurselle Serterol Superlipid probucol probucolum |
|
| has_RxCUI |
8699 |
|
| id |
CHEBI:8427 |
|
| in_subset | ||
| inchi |
InChI=1S/C31H48O2S2/c1-27(2,3)21-15-19(16-22(25(21)32)28(4,5)6)34-31(13,14)35-20-17-23(29(7,8)9)26(33)24(18-20)30(10,11)12/h15-18,32-33H,1-14H3 |
|
| inchikey |
FYPMFJGVHOHGLL-UHFFFAOYSA-N |
|
| label |
probucol |
|
| mass |
516.84200 |
|
| monoisotopicmass |
516.30957 |
|
| notation |
CHEBI:8427 |
|
| prefLabel |
probucol |
|
| smiles |
CC(C)(Sc1cc(c(O)c(c1)C(C)(C)C)C(C)(C)C)Sc1cc(c(O)c(c1)C(C)(C)C)C(C)(C)C |
|
| subClassOf |