loading...| Preferred Name | (R,R)-tramadol | |
| Synonyms |
(+)-trans-2-(Dimethylaminomethyl)-1-(m-methoxyphenyl)cyclohexanol (+)-tramadol (1R,2R)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexanol |
|
| Definitions |
A 2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexanol in which both stereocentres have R-configuration; the (R,R)-enantiomer of the racemic opioid analgesic tramadol, it exhibits ten-fold higher analgesic potency than the (S,S)-enantiomer. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_75725 |
|
| alternative label |
(+)-trans-2-(Dimethylaminomethyl)-1-(m-methoxyphenyl)cyclohexanol (+)-tramadol (1R,2R)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexanol |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D08623 Wikipedia:Tramadol Reaxys:9590387 LINCS:LSM-5221 KEGG:C07153 CAS:123154-38-1 CAS:27203-92-5 VSDB:3008 |
|
| definition |
A 2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexanol in which both stereocentres have R-configuration; the (R,R)-enantiomer of the racemic opioid analgesic tramadol, it exhibits ten-fold higher analgesic potency than the (S,S)-enantiomer. |
|
| formula |
C16H25NO2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_64054 http://purl.obolibrary.org/obo/CHEBI_50949 http://purl.obolibrary.org/obo/CHEBI_48878 http://purl.obolibrary.org/obo/CHEBI_48876 http://purl.obolibrary.org/obo/CHEBI_55322 http://purl.obolibrary.org/obo/CHEBI_48279 http://purl.obolibrary.org/obo/CHEBI_25212 http://purl.obolibrary.org/obo/CHEBI_70774 http://purl.obolibrary.org/obo/CHEBI_35640 http://purl.obolibrary.org/obo/CHEBI_59282 http://purl.obolibrary.org/obo/CHEBI_60643 |
|
| has_exact_synonym |
(1R,2R)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexanol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(+)-trans-2-(Dimethylaminomethyl)-1-(m-methoxyphenyl)cyclohexanol (+)-tramadol |
|
| id |
CHEBI:75725 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H25NO2/c1-17(2)12-14-7-4-5-10-16(14,18)13-8-6-9-15(11-13)19-3/h6,8-9,11,14,18H,4-5,7,10,12H2,1-3H3/t14-,16+/m1/s1 |
|
| inchikey |
TVYLLZQTGLZFBW-ZBFHGGJFSA-N |
|
| is conjugate base of | ||
| is enantiomer of | ||
| label |
(R,R)-tramadol |
|
| mass |
263.37520 |
|
| monoisotopicmass |
263.18853 |
|
| notation |
CHEBI:75725 |
|
| prefLabel |
(R,R)-tramadol |
|
| smiles |
COc1cccc(c1)[C@@]1(O)CCCC[C@@H]1CN(C)C |
|
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/CHEBI_75725 | PDRO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_75725 | FIDEO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_75725 | DINTO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_75725 | BERO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_75725 | DDSS | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_75725 | CHEBI | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_75725 | ECTO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_75725 | PDRO | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_75725 | DINTO | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_75725 | BERO | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_75725 | DDSS | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_75725 | CHEBI | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_75725 | ECTO | LOOM |