Preferred Name |
Amisulpride |
|
Synonyms |
4-amino-N-[(1-ethylpyrrolidin-2-yl)methyl]-5-(ethylsulfonyl)-2-methoxybenzamide 4-Amino-N-((1-ethyl-2-pyrrolidinyl)methyl)-5-(ethylsulfonyl)-2-methoxybenzamide 4-Amino-N-((1-ethyl-2-pyrrolidinyl)methyl)-5-(ethylsulfonyl)-o-anisamide amisulprida amisulpride amisulpridum Aminosultopride |
|
Definitions |
A member of the class of benzamides resulting from the formal condensation of the carboxy group of 4-amino-5-(ethylsulfonyl)-2-methoxybenzoic acid with the primary amino group of 2-(aminomethyl)-1-ethylpyrrolidine. It is a potent, selective dopamine D2 and D3 receptor antagonist. It is an atypical antipsychotic/antischizophrenic agent with limited extrapyrimidal side effects. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_64045 |
|
charge |
0 |
|
database_cross_reference |
PMID:22121864 PMID:21176108 PMID:22241281 Wikipedia:Amisulpride HMDB:HMDB0015633 DrugBank:DB06288 PMID:21746752 PMID:22250612 PMID:21647545 PMID:22035899 PMID:21888613 KEGG:D07310 PMID:21852060 PMID:21969105 Drug_Central:179 PMID:21822161 PMID:21845006 LINCS:LSM-1669 PMID:21663752 PMID:22059694 Reaxys:6876191 CAS:71675-85-9 Patent:US4401822 PMID:21886905 Patent:BE872585 |
|
definition |
A member of the class of benzamides resulting from the formal condensation of the carboxy group of 4-amino-5-(ethylsulfonyl)-2-methoxybenzoic acid with the primary amino group of 2-(aminomethyl)-1-ethylpyrrolidine. It is a potent, selective dopamine D2 and D3 receptor antagonist. It is an atypical antipsychotic/antischizophrenic agent with limited extrapyrimidal side effects. |
|
formula |
C17H27N3O4S |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35703 |
|
has_exact_synonym |
4-amino-N-[(1-ethylpyrrolidin-2-yl)methyl]-5-(ethylsulfonyl)-2-methoxybenzamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
4-Amino-N-((1-ethyl-2-pyrrolidinyl)methyl)-5-(ethylsulfonyl)-2-methoxybenzamide 4-Amino-N-((1-ethyl-2-pyrrolidinyl)methyl)-5-(ethylsulfonyl)-o-anisamide amisulprida amisulpride amisulpridum Aminosultopride |
|
has_RxCUI |
46303 |
|
id |
CHEBI:64045 |
|
in_subset | ||
inchi |
InChI=1S/C17H27N3O4S/c1-4-20-8-6-7-12(20)11-19-17(21)13-9-16(25(22,23)5-2)14(18)10-15(13)24-3/h9-10,12H,4-8,11,18H2,1-3H3,(H,19,21) |
|
inchikey |
NTJOBXMMWNYJFB-UHFFFAOYSA-N |
|
label |
amisulpride Amisulpride |
|
mass |
369.47900 |
|
monoisotopicmass |
369.17223 |
|
notation |
CHEBI:64045 |
|
prefLabel |
Amisulpride |
|
smiles |
CCN1CCCC1CNC(=O)c1cc(c(N)cc1OC)S(=O)(=O)CC |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35850 http://purl.obolibrary.org/obo/CHEBI_33860 |