Preferred Name | indometacin | |
Synonyms |
indometacina 1-(p-chlorobenzoyl)-5-methoxy-2-methylindole-3-acetic acid indometacin {1-[(4-chlorophenyl)carbonyl]-5-methoxy-2-methyl-1H-indol-3-yl}acetic acid indometacine indometacinum Indomethacin Aconip Indocin [1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetic acid |
|
Definitions |
A member of the class of indole-3-acetic acids that is indole-3-acetic acid in which the indole ring is substituted at positions 1, 2 and 5 by p-chlorobenzoyl, methyl, and methoxy groups, respectively. A non-steroidal anti-inflammatory drug, it is used in the treatment of musculoskeletal and joint disorders including osteoarthritis, rheumatoid arthritis, gout, bursitis and tendinitis. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_49662 |
|
alternative label |
indometacina 1-(p-chlorobenzoyl)-5-methoxy-2-methylindole-3-acetic acid indometacin {1-[(4-chlorophenyl)carbonyl]-5-methoxy-2-methyl-1H-indol-3-yl}acetic acid indometacine indometacinum Indomethacin Aconip Indocin [1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetic acid |
|
charge |
0 |
|
database_cross_reference |
Gmelin:1446006 Reaxys:497341 PDBeChem:IMN DrugBank:DB00328 Drug_Central:1440 KEGG:D00141 LINCS:LSM-3275 Patent:US3161654 PMID:22931205 CAS:53-86-1 PMID:23992308 Wikipedia:Indometacin MetaCyc:CPD-10545 PMID:28166217 Beilstein:497341 PMID:6039425 PMID:5952296 Patent:BE379378 KEGG:C01926 HMDB:HMDB0014473 KNApSAcK:C00030512 |
|
definition |
A member of the class of indole-3-acetic acids that is indole-3-acetic acid in which the indole ring is substituted at positions 1, 2 and 5 by p-chlorobenzoyl, methyl, and methoxy groups, respectively. A non-steroidal anti-inflammatory drug, it is used in the treatment of musculoskeletal and joint disorders including osteoarthritis, rheumatoid arthritis, gout, bursitis and tendinitis. |
|
formula |
C19H16ClNO4 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35845 http://purl.obolibrary.org/obo/CHEBI_49103 http://purl.obolibrary.org/obo/CHEBI_35544 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_35480 |
|
has_alternative_id |
CHEBI:49660 CHEBI:5918 |
|
has_exact_synonym |
[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
indometacina 1-(p-chlorobenzoyl)-5-methoxy-2-methylindole-3-acetic acid indometacin {1-[(4-chlorophenyl)carbonyl]-5-methoxy-2-methyl-1H-indol-3-yl}acetic acid indometacine indometacinum Indomethacin Aconip Indocin |
|
has_RxCUI |
5781 |
|
id |
CHEBI:49662 |
|
in_subset | ||
inchi |
InChI=1S/C19H16ClNO4/c1-11-15(10-18(22)23)16-9-14(25-2)7-8-17(16)21(11)19(24)12-3-5-13(20)6-4-12/h3-9H,10H2,1-2H3,(H,22,23) |
|
inchikey |
CGIGDMFJXJATDK-UHFFFAOYSA-N |
|
is_bearer_of | ||
label |
indometacin |
|
mass |
357.78800 |
|
monoisotopicmass |
357.07679 |
|
notation |
CHEBI:49662 |
|
prefLabel |
indometacin |
|
smiles |
COc1ccc2n(C(=O)c3ccc(Cl)cc3)c(C)c(CC(O)=O)c2c1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_24803 http://purl.obolibrary.org/obo/CHEBI_75884 |