Preferred Name | thiabendazole | |
Synonyms |
2-(4-thiazolyl)-1H-benzimidazole 2-(1,3-thiazol-4-yl)benzimidazole Tiabendazole 2-(1,3-THIAZOL-4-YL)-1H-BENZIMIDAZOLE 4-(2-benzimidazolyl)thiazole 2-(thiazol-4-yl)benzimidazole Equizole MK 360 Mintezol TBZ Thibenzole 2-(1,3-thiazol-4-yl)-1H-benzimidazole Thiabendazole |
|
Definitions |
A member of the class of benzimidazoles carrying a 1,3-thiazol-4-yl substituent at position 2. A mainly post-harvest fungicide used to control a wide range of diseases including Aspergillus, Botrytis, Cladosporium and Fusarium. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_45979 |
|
alternative label |
2-(4-thiazolyl)-1H-benzimidazole 2-(1,3-thiazol-4-yl)benzimidazole Tiabendazole 2-(1,3-THIAZOL-4-YL)-1H-BENZIMIDAZOLE 4-(2-benzimidazolyl)thiazole 2-(thiazol-4-yl)benzimidazole Equizole MK 360 Mintezol TBZ Thibenzole 2-(1,3-thiazol-4-yl)-1H-benzimidazole Thiabendazole |
|
charge |
0 |
|
database_cross_reference |
PDBeChem:TMG PMID:23790859 Beilstein:611403 MetaCyc:THIABENDAZOLE Wikipedia:Thiabendazole PMID:11226373 PMID:9009055 PMID:13900465 LINCS:LSM-3741 DrugBank:DB00730 KEGG:D00372 CAS:148-79-8 Pesticides:thiabendazole Reaxys:611403 Patent:US3017415 Drug_Central:2621 HMDB:HMDB0014868 PPDB:629 VSDB:629 |
|
definition |
A member of the class of benzimidazoles carrying a 1,3-thiazol-4-yl substituent at position 2. A mainly post-harvest fungicide used to control a wide range of diseases including Aspergillus, Botrytis, Cladosporium and Fusarium. |
|
formula |
C10H7N3S |
|
has parent hydride | ||
has role | ||
has_alternative_id |
CHEBI:45977 CHEBI:9526 |
|
has_exact_synonym |
2-(1,3-thiazol-4-yl)-1H-benzimidazole Thiabendazole |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-(4-thiazolyl)-1H-benzimidazole 2-(1,3-thiazol-4-yl)benzimidazole Tiabendazole 2-(1,3-THIAZOL-4-YL)-1H-BENZIMIDAZOLE 4-(2-benzimidazolyl)thiazole 2-(thiazol-4-yl)benzimidazole Equizole MK 360 Mintezol TBZ Thibenzole |
|
has_RxCUI |
10450 |
|
id |
CHEBI:45979 |
|
in_subset | ||
inchi |
InChI=1S/C10H7N3S/c1-2-4-8-7(3-1)12-10(13-8)9-5-14-6-11-9/h1-6H,(H,12,13) |
|
inchikey |
WJCNZQLZVWNLKY-UHFFFAOYSA-N |
|
label |
thiabendazole |
|
mass |
201.24800 |
|
monoisotopicmass |
201.03607 |
|
notation |
CHEBI:45979 |
|
prefLabel |
thiabendazole |
|
smiles |
c1nc(cs1)-c1nc2ccccc2[nH]1 |
|
subClassOf |