loading...| Preferred Name | strychnine | |
| Synonyms |
Strychnin strychnidin-10-one Strychnine |
|
| Definitions |
A monoterpenoid indole alkaloid that is strychnidine bearing a keto substituent at the 10-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28973 |
|
| alternative label |
Strychnin strychnidin-10-one Strychnine |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:52979 PMID:12742643 CAS:57-24-9 PMID:26330182 Wikipedia:Strychnine PMID:17900376 PMID:20810461 PMID:17145135 PMID:19194159 PMID:10471592 PMID:21506420 PMID:14575889 KNApSAcK:C00001770 PMID:16887371 Reaxys:52979 PMID:17365101 KEGG:C06522 PMID:19445923 PMID:14552874 PMID:15601738 PMID:26173662 PMID:26223366 PMID:25702781 PMID:10821054 PMID:12611967 KNApSAcK:C00025213 PMID:21618309 PMID:19617896 PMID:26416729 PMID:21726589 PMID:16950410 PMID:22417832 PMID:19071748 PMID:15046720 PMID:14530208 Gmelin:117894 PMID:9918589 PMID:19628662 PMID:21109870 PMID:11324564 PMID:25958869 PMID:11900860 PMID:19200346 PMID:16075189 PMID:16171972 PMID:11453337 PMID:12757728 PMID:15302677 PMID:23395890 PMID:11516560 PMID:12718443 PMID:15610168 PMID:21666516 PMID:17827655 PMID:19394327 PMID:22168233 PMID:17449162 PMID:21616062 PMID:21468359 PMID:18199816 PMID:11024105 PMID:20837125 PMID:25877308 PMID:26028680 PMID:17595105 PMID:21042643 PMID:20534469 Drug_Central:2484 PMID:26556179 PMID:26625339 PDBeChem:SY9 PMID:11157095 PMID:11327524 PMID:15275654 PMID:21532268 BPDB:2066 |
|
| definition |
A monoterpenoid indole alkaloid that is strychnidine bearing a keto substituent at the 10-position. |
|
| formula |
C21H22N2O2 |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_33289 http://purl.obolibrary.org/obo/CHEBI_33288 |
|
| has_alternative_id |
CHEBI:26795 CHEBI:9293 |
|
| has_exact_synonym |
strychnidin-10-one Strychnine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Strychnin |
|
| has_RxCUI |
66422 |
|
| id |
CHEBI:28973 |
|
| in_subset | ||
| inchi |
InChI=1S/C21H22N2O2/c24-18-10-16-19-13-9-17-21(6-7-22(17)11-12(13)5-8-25-16)14-3-1-2-4-15(14)23(18)20(19)21/h1-5,13,16-17,19-20H,6-11H2/t13-,16-,17-,19-,20-,21+/m0/s1 |
|
| inchikey |
QMGVPVSNSZLJIA-FVWCLLPLSA-N |
|
| is conjugate base of | ||
| label |
strychnine |
|
| mass |
334.41160 |
|
| monoisotopicmass |
334.16813 |
|
| notation |
CHEBI:28973 |
|
| prefLabel |
strychnine |
|
| smiles |
[H][C@@]12CC(=O)N3c4ccccc4[C@]45CCN6CC(=CCO1)[C@]([H])(C[C@@]46[H])[C@]2([H])[C@]35[H] |
|
| subClassOf |