loading...| Preferred Name | octadecanoic acid | |
| Synonyms |
Oktadekansaeure STEARIC ACID octadecoic acid stearic acid CH3-[CH2]16-COOH acide stearique Octadecansaeure n-octadecanoic acid Stearinsaeure acide octadecanoique 18:0 C18:0 Octadecanoic acid octadecanoic acid |
|
| Definitions |
A C18 straight-chain saturated fatty acid component of many animal and vegetable lipids. As well as in the diet, it is used in hardening soaps, softening plastics and in making cosmetics, candles and plastics. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28842 |
|
| alternative label |
Oktadekansaeure STEARIC ACID octadecoic acid stearic acid CH3-[CH2]16-COOH acide stearique Octadecansaeure n-octadecanoic acid Stearinsaeure acide octadecanoique 18:0 C18:0 Octadecanoic acid octadecanoic acid |
|
| charge |
0 |
|
| database_cross_reference |
HMDB:HMDB0000827 PMID:16448636 KEGG:D00119 CAS:57-11-4 LIPID_MAPS_instance:LMFA01010018 PMID:19838949 KEGG:C01530 PMID:17439666 Gmelin:11738 Reaxys:608585 Drug_Central:4611 MetaCyc:STEARIC_ACID Wikipedia:Stearic_acid Beilstein:608585 PMID:22735334 KNApSAcK:C00001238 PDBeChem:STE PMID:7763343 DrugBank:DB03193 PMID:11425337 PMID:18982377 PMID:19468063 PMID:26884207 |
|
| definition |
A C18 straight-chain saturated fatty acid component of many animal and vegetable lipids. As well as in the diet, it is used in hardening soaps, softening plastics and in making cosmetics, candles and plastics. |
|
| formula |
C18H36O2 |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_83056 |
|
| has_alternative_id |
CHEBI:45710 CHEBI:25631 |
|
| has_exact_synonym |
Octadecanoic acid octadecanoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Oktadekansaeure STEARIC ACID octadecoic acid stearic acid CH3-[CH2]16-COOH acide stearique Octadecansaeure n-octadecanoic acid Stearinsaeure acide octadecanoique 18:0 C18:0 |
|
| id |
CHEBI:28842 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20) |
|
| inchikey |
QIQXTHQIDYTFRH-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
octadecanoic acid |
|
| mass |
284.478 |
|
| monoisotopicmass |
284.27153 |
|
| notation |
CHEBI:28842 |
|
| prefLabel |
octadecanoic acid |
|
| smiles |
C(CCCCCCCCCC)CCCCCCC(=O)O |
|
| subClassOf |