Preferred Name |
nitroglycerin |
|
Synonyms |
1,2,3-propanetriyl nitrate trinitroglycerol trinitroglycerin 1,2,3-propanetrioltrinitrate glycerin trinitrate nitroglycerol nitroglycerine propane-1,2,3-triyl trinitrate glycerol trinitrate Transderm Nitro glycerol, nitric acid triester Glyceryl trinitrate Nitrolingual Minitran NG Natispray Nitro-Dur Nitromist Nitrostat Rectogesic 1,2,3-trinitrooxypropane Nitroglycerin |
|
Definitions |
A nitroglycerol that is glycerol in which the hydrogen atoms of all three hydroxy groups are replaced by nitro groups. It acts as a prodrug, releasing nitric oxide to open blood vessels and so alleviate heart pain. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28787 |
|
alternative label |
1,2,3-propanetriyl nitrate trinitroglycerol trinitroglycerin 1,2,3-propanetrioltrinitrate glycerin trinitrate nitroglycerol nitroglycerine propane-1,2,3-triyl trinitrate glycerol trinitrate Transderm Nitro glycerol, nitric acid triester Glyceryl trinitrate Nitrolingual Minitran NG Natispray Nitro-Dur Nitromist Nitrostat Rectogesic 1,2,3-trinitrooxypropane Nitroglycerin |
|
charge |
0 |
|
database_cross_reference |
UM-BBD_compID:c0061 DrugBank:DB00727 CAS:55-63-0 Wikipedia:Nitroglycerin PMID:22040938 Beilstein:1802063 KEGG:C07455 Reaxys:1802063 PMID:23205544 PMID:23301717 Drug_Central:1952 Wikipedia:Glyceryl_trinitrate_(pharmacology) PMID:11943517 Gmelin:165859 PMID:11470751 PMID:9492718 PMID:11016328 KEGG:D00515 PMID:22675243 |
|
definition |
A nitroglycerol that is glycerol in which the hydrogen atoms of all three hydroxy groups are replaced by nitro groups. It acts as a prodrug, releasing nitric oxide to open blood vessels and so alleviate heart pain. |
|
formula |
C3H5N3O9 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_51371 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_35620 http://purl.obolibrary.org/obo/CHEBI_66993 http://purl.obolibrary.org/obo/CHEBI_63490 |
|
has_alternative_id |
CHEBI:25559 CHEBI:7595 |
|
has_exact_synonym |
1,2,3-trinitrooxypropane Nitroglycerin |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
1,2,3-propanetriyl nitrate trinitroglycerol trinitroglycerin 1,2,3-propanetrioltrinitrate glycerin trinitrate nitroglycerol nitroglycerine propane-1,2,3-triyl trinitrate glycerol trinitrate Transderm Nitro glycerol, nitric acid triester Glyceryl trinitrate Nitrolingual Minitran NG Natispray Nitro-Dur Nitromist Nitrostat Rectogesic |
|
has_RxCUI |
4917 |
|
id |
CHEBI:28787 |
|
in_subset | ||
inchi |
InChI=1S/C3H5N3O9/c7-4(8)13-1-3(15-6(11)12)2-14-5(9)10/h3H,1-2H2 |
|
inchikey |
SNIOPGDIGTZGOP-UHFFFAOYSA-N |
|
label |
Nitroglycerin nitroglycerin |
|
mass |
227.08650 |
|
monoisotopicmass |
227.00258 |
|
notation |
CHEBI:28787 |
|
prefLabel |
nitroglycerin |
|
smiles |
[O-][N+](=O)OCC(CO[N+]([O-])=O)O[N+]([O-])=O |
|
subClassOf |