loading...| Preferred Name | hesperetin | |
| Synonyms |
(S)-2,3-dihydro-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one (-)-hesperetin 3',5,7-Trihydroxy-4'-methoxyflavanone (-)-(S)-hesperetin (2S)-hesperetin (2S)-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one Hesperetin |
|
| Definitions |
A trihydroxyflavanone having the three hydroxy gropus located at the 3'-, 5- and 7-positions and an additional methoxy substituent at the 4'-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28230 |
|
| alternative label |
(S)-2,3-dihydro-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one (-)-hesperetin 3',5,7-Trihydroxy-4'-methoxyflavanone (-)-(S)-hesperetin (2S)-hesperetin (2S)-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one Hesperetin |
|
| charge |
0 |
|
| database_cross_reference |
PMID:22409373 Drug_Central:1362 KEGG:C01709 PMID:22899565 LIPID_MAPS_instance:LMPK12140003 CAS:520-33-2 Beilstein:92705 Reaxys:92705 KNApSAcK:C00000968 Wikipedia:Hesperetin PMID:16964766 HMDB:HMDB0005782 PMID:22903244 MetaCyc:CPD-7072 DrugBank:DB01094 PMID:22794525 LINCS:LSM-20933 |
|
| definition |
A trihydroxyflavanone having the three hydroxy gropus located at the 3'-, 5- and 7-positions and an additional methoxy substituent at the 4'-position. |
|
| formula |
C16H14O6 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
| has_alternative_id |
CHEBI:24529 CHEBI:5681 |
|
| has_exact_synonym |
(2S)-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one Hesperetin |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(S)-2,3-dihydro-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one (-)-hesperetin 3',5,7-Trihydroxy-4'-methoxyflavanone (-)-(S)-hesperetin (2S)-hesperetin |
|
| id |
CHEBI:28230 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H14O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-6,14,17-19H,7H2,1H3/t14-/m0/s1 |
|
| inchikey |
AIONOLUJZLIMTK-AWEZNQCLSA-N |
|
| is conjugate acid of | ||
| label |
hesperetin |
|
| mass |
302.27880 |
|
| monoisotopicmass |
302.07904 |
|
| notation |
CHEBI:28230 |
|
| prefLabel |
hesperetin |
|
| smiles |
COc1ccc(cc1O)[C@@H]1CC(=O)c2c(O)cc(O)cc2O1 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_140332 http://purl.obolibrary.org/obo/CHEBI_48024 |