Preferred Name | resorcinol | |
Synonyms |
1,3-Dihydroxybenzene 1,3-Dihydroxybenzol m-hydroxyphenol m-Hydroquinone 1,3-Benzenediol Resorcin Resorzin benzene-1,3-diol RESORCINOL Resorcinol resorcinol |
|
Definitions |
A benzenediol that is benzene dihydroxylated at positions 1 and 3. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27810 |
|
alternative label |
1,3-Dihydroxybenzene 1,3-Dihydroxybenzol m-hydroxyphenol m-Hydroquinone 1,3-Benzenediol Resorcin Resorzin benzene-1,3-diol RESORCINOL Resorcinol resorcinol |
|
charge |
0 |
|
database_cross_reference |
PMID:3263257 KEGG:D00133 UM-BBD_compID:c0265 Wikipedia:Resorcinol PMID:23352755 PDBeChem:RCO KNApSAcK:C00002671 PMID:11792395 Reaxys:906905 PMID:29079364 Beilstein:906905 CAS:108-46-3 Gmelin:26734 KEGG:C01751 HMDB:HMDB0032037 Drug_Central:3524 PMID:24269627 MetaCyc:CPD-623 |
|
definition |
A benzenediol that is benzene dihydroxylated at positions 1 and 3. |
|
formula |
C6H6O2 |
|
has role | ||
has_alternative_id |
CHEBI:45349 CHEBI:26532 CHEBI:8812 |
|
has_exact_synonym |
benzene-1,3-diol RESORCINOL Resorcinol resorcinol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
1,3-Dihydroxybenzene 1,3-Dihydroxybenzol m-hydroxyphenol m-Hydroquinone 1,3-Benzenediol Resorcin Resorzin |
|
has_RxCUI |
35382 |
|
id |
CHEBI:27810 |
|
in_subset | ||
inchi |
InChI=1S/C6H6O2/c7-5-2-1-3-6(8)4-5/h1-4,7-8H |
|
inchikey |
GHMLBKRAJCXXBS-UHFFFAOYSA-N |
|
label |
resorcinol |
|
mass |
110.11064 |
|
monoisotopicmass |
110.03678 |
|
notation |
CHEBI:27810 |
|
prefLabel |
resorcinol |
|
smiles |
Oc1cccc(O)c1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_17701 |