Preferred Name |
Amoxapine |
|
Synonyms |
2-chloro-11-(piperazin-1-yl)dibenzo[b,f][1,4]oxazepine Desmethylloxapin 2-Chloro-11-(1-piperazinyl)dibenz(b,f)(1,4)oxazepine amoxapina amoxapine amoxapinum |
|
Definitions |
A dibenzooxazepine compound having a chloro substituent at the 2-position and a piperazin-1-yl group at the 11-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_2675 |
|
charge |
0 |
|
database_cross_reference |
Beilstein:832057 KEGG:D00228 Wikipedia:Amoxapine CAS:14028-44-5 DrugBank:DB00543 Drug_Central:191 LINCS:LSM-2021 PMID:24134630 Patent:FR1508536 Patent:US3663696 |
|
definition |
A dibenzooxazepine compound having a chloro substituent at the 2-position and a piperazin-1-yl group at the 11-position. |
|
formula |
C17H16ClN3O |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_176497 http://purl.obolibrary.org/obo/CHEBI_50949 http://purl.obolibrary.org/obo/CHEBI_48561 |
|
has_exact_synonym |
2-chloro-11-(piperazin-1-yl)dibenzo[b,f][1,4]oxazepine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Desmethylloxapin 2-Chloro-11-(1-piperazinyl)dibenz(b,f)(1,4)oxazepine amoxapina amoxapine amoxapinum |
|
has_RxCUI |
722 |
|
id |
CHEBI:2675 |
|
in_subset | ||
inchi |
InChI=1S/C17H16ClN3O/c18-12-5-6-15-13(11-12)17(21-9-7-19-8-10-21)20-14-3-1-2-4-16(14)22-15/h1-6,11,19H,7-10H2 |
|
inchikey |
QWGDMFLQWFTERH-UHFFFAOYSA-N |
|
label |
Amoxapine amoxapine |
|
mass |
313.78100 |
|
monoisotopicmass |
313.09819 |
|
notation |
CHEBI:2675 |
|
prefLabel |
Amoxapine |
|
smiles |
Clc1ccc2Oc3ccccc3N=C(N3CCNCC3)c2c1 |
|
subClassOf |