Preferred Name | catechin | |
Synonyms |
(+/-)-Catechin catechins catechin |
|
Definitions |
Members of the class of hydroxyflavan that have a flavan-3-ol skeleton and its substituted derivatives. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_23053 |
|
alternative label |
(+/-)-Catechin catechins catechin |
|
charge |
0 |
|
database_cross_reference |
KEGG:C17590 LINCS:LSM-1682 |
|
definition |
Members of the class of hydroxyflavan that have a flavan-3-ol skeleton and its substituted derivatives. |
|
formula |
C15H14O6 |
|
has_exact_synonym |
catechin |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(+/-)-Catechin catechins |
|
id |
CHEBI:23053 |
|
in_subset | ||
inchi |
InChI=1S/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2 |
|
inchikey |
PFTAWBLQPZVEMU-UHFFFAOYSA-N |
|
label |
catechin |
|
mass |
290.269 |
|
monoisotopicmass |
290.07904 |
|
notation |
CHEBI:23053 |
|
prefLabel |
catechin |
|
smiles |
C1(C=2C=C(C(O)=CC2)O)OC=3C(=C(C=C(C3)O)O)CC1O |
|
subClassOf |
Create mapping