Preferred Name |
thiopental |
|
Synonyms |
5-ethyl-5-(pentan-2-yl)-2-thioxodihydropyrimidine-4,6(1H,5H)-dione Thiopental 2-Thio-5-ethyl-5-sec-pentylbarbituric acid Thiopentobarbital Thiopentone Thiopentobarbitone Thiopentobarbituric acid 5-Ethyl-5-(1-methyl-butyl)-2-thioxo-dihydro-pyrimidine-4,6-dione (+-)-thiopental Penthiobarbital Pentothiobarbital |
|
Definitions |
A barbiturate, the structure of which is that of 2-thiobarbituric acid substituted at C-5 by ethyl and sec-pentyl groups. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_102166 |
|
charge |
0 |
|
database_cross_reference |
CAS:76-75-5 Reaxys:209361 PMID:2215478 PMID:23490495 PMID:20488867 PMID:9699097 PMID:23305916 PMID:23644730 Beilstein:209361 PMID:23542731 DrugBank:DB00599 PMID:16897573 KEGG:C07521 PMID:9171876 Drug_Central:2633 PMID:6864729 PMID:23422796 PMID:23879844 PMID:16166909 PMID:18484074 PMID:15857133 PMID:10841799 PMID:10666006 PMID:3654008 |
|
definition |
A barbiturate, the structure of which is that of 2-thiobarbituric acid substituted at C-5 by ethyl and sec-pentyl groups. |
|
formula |
C11H18N2O2S |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_38877 http://purl.obolibrary.org/obo/CHEBI_35717 http://purl.obolibrary.org/obo/CHEBI_88188 |
|
has_alternative_id |
CHEBI:9560 |
|
has_exact_synonym |
5-ethyl-5-(pentan-2-yl)-2-thioxodihydropyrimidine-4,6(1H,5H)-dione Thiopental |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-Thio-5-ethyl-5-sec-pentylbarbituric acid Thiopentobarbital Thiopentone Thiopentobarbitone Thiopentobarbituric acid 5-Ethyl-5-(1-methyl-butyl)-2-thioxo-dihydro-pyrimidine-4,6-dione (+-)-thiopental Penthiobarbital Pentothiobarbital |
|
has_RxCUI |
10493 |
|
id |
CHEBI:102166 |
|
in_subset | ||
inchi |
InChI=1S/C11H18N2O2S/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16) |
|
inchikey |
IUJDSEJGGMCXSG-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
Thiopental thiopental |
|
mass |
242.33800 |
|
monoisotopicmass |
242.10890 |
|
notation |
CHEBI:102166 |
|
prefLabel |
thiopental |
|
smiles |
CCCC(C)C1(CC)C(=O)NC(=S)NC1=O |
|
subClassOf |