Preferred Name |
lisdexamfetamine |
|
Synonyms |
C15H25N3O (2S)-2,6-diamino-N-[(2S)-1-phenylpropan-2-yl]hexanamide |
|
ID |
http://purl.obolibrary.org/obo/dinto_DB01255 |
|
blocks | ||
CASRN |
608137-32-2 |
|
DBBrand |
vyvanse |
|
DBSynonym |
nrp104 lisdexamfetamine dimesylate |
|
Definition |
Lisdexamfetamine (L-lysine-d-amphetamine) is a prodrug of the psychostimulant d-amphetamine coupled with the essential amino acid L-lysine. It was developed so that the amphetamine psychostimulant is released and activated more slowly as the prodrug molecule is hydrolyzed consequently cleaving off the amino acid-during the first pass through the intestines and/or the liver. Amphetamines target the trace amine-associated receptor 1 (TAAR1). Amphetamine is also believed to exert its effects by binding to the monoamine transporters (the dopamine transporter or DAT) and increasing extracellular levels of the biogenic amines dopamine, norepinephrine (noradrenaline) and serotonin. |
|
has pharmacological target | ||
InChI |
InChI=1S/C15H25N3O/c1-12(11-13-7-3-2-4-8-13)18-15(19)14(17)9-5-6-10-16/h2-4,7-8,12,14H,5-6,9-11,16-17H2,1H3,(H,18,19)/t12-,14-/m0/s1 |
|
InChIKey |
InChIKey=VOBHXZCDAVEXEY-JSGCOSHPSA-N |
|
inhibits | ||
label |
lisdexamfetamine |
|
may interact with |
http://purl.obolibrary.org/obo/CHEBI_32250 http://purl.obolibrary.org/obo/dinto_DB00519 |
|
prefixIRI |
obo2:dinto_DB01255 |
|
prefLabel |
lisdexamfetamine |
|
SMILES |
C[C@@H](CC1=CC=CC=C1)NC(=O)[C@@H](N)CCCCN |
|
Synonym |
C15H25N3O (2S)-2,6-diamino-N-[(2S)-1-phenylpropan-2-yl]hexanamide |
|
xref |
PubChem Compound:11597698 PharmGKB:PA164748975 National Drug Code Directory:59417-102-10 Wikipedia:http://en.wikipedia.org/wiki/Lisdexamfetamine ChemSpider:9772458 RxList:http://www.rxlist.com/cgi/generic/vyvanse.htm PubChem Substance:46505358 |
|
subClassOf |