loading...| Preferred Name | hexachlorophene | |
| Synonyms |
C13H6Cl6O2 3,4,6-trichloro-2-[(2,3,5-trichloro-6-hydroxyphenyl)methyl]phenol |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00756 |
|
| AHFScode |
84:04.92 |
|
| ATCCode |
D08AE01 |
|
| binds |
http://purl.obolibrary.org/obo/dinto_2802 |
|
| CASRN |
70-30-4 |
|
| DBBrand |
surofene fostril turgex nabac g-ii steraskin septofen trichlorophene hexosan phiso-scrub hexa-germ hexabalm surgi-cin dermadex tersaseptic rcra waste number u132 hexophene acigena hexascrub ster-zac e-z scrub distodin fascol bivelon gamophene eleven ritosept g-eleven at-7 septi-soft phisohex fomac hexachlorophen neosept v gamophen phisodan hexachlorophene, pharma hexafen exofene germa-medica fesia-sin almederm scrubteam surgical spongebrush cotofilm septisol soy-dome nabac 25 ec pre-op steral isobac 20 surgi-cen bilevon isobac compound g-11 hexide hexachlorophane hexazinone hexachlorofen |
|
| Definition |
A chlorinated bisphenol antiseptic with a bacteriostatic action against Gram-positive organisms, but much less effective against Gram-negative organisms. It is mainly used in soaps and creams and is an ingredient of various preparations used for skin disorders. (From Martindale, The Extra Pharmacopoeia, 30th ed, p797) |
|
| has effect | ||
| has pharmacological target | ||
| InChI |
InChI=1S/C13H6Cl6O2/c14-6-2-8(16)12(20)4(10(6)18)1-5-11(19)7(15)3-9(17)13(5)21/h2-3,20-21H,1H2 |
|
| InChIKey |
InChIKey=ACGUYXCXAPNIKK-UHFFFAOYSA-N |
|
| inhibits |
http://purl.obolibrary.org/obo/dinto_2802 |
|
| label |
hexachlorophene |
|
| prefixIRI |
obo2:dinto_DB00756 |
|
| prefLabel |
hexachlorophene |
|
| SMILES |
OC1=C(CC2=C(O)C(Cl)=CC(Cl)=C2Cl)C(Cl)=C(Cl)C=C1Cl |
|
| Synonym |
C13H6Cl6O2 3,4,6-trichloro-2-[(2,3,5-trichloro-6-hydroxyphenyl)methyl]phenol |
|
| xref |
PharmGKB:PA449871 Drugs.com:http://www.drugs.com/cdi/hexachlorophene.html RxList:http://www.rxlist.com/cgi/generic2/hexchlorph.htm National Drug Code Directory:0024-1535-02 Wikipedia:http://en.wikipedia.org/wiki/Hexachlorophene PubChem Compound:3598 PubChem Substance:46505858 ChemSpider:3472 Drugs Product Database (DPD):2017733 |
|
| subClassOf |