loading...| Preferred Name | calcium carbonate | |
| Synonyms |
CaCO3 CO3.Ca Kalziumkarbonat carbonate de calcium calcium trioxidocarbonate carbonic acid calcium salt (1:1) CCaO3 kohlensaurer Kalk calcium carbonate carbonato de calcio Calcium carbonate calcium carbonate (1:1) Calciumcarbonat |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3311 |
|
| AHFScode |
56:04 40:12 |
|
| ATCCode |
A02AC01 A12AA04 |
|
| Definition |
A carbonate salt that has formula CO3.Ca. Calcium carbonate is an inorganic salt used as an antacid. It is a basic compound that acts by neutralizing hydrochloric acid in gastric secretions. Subsequent increases in pH may inhibit the action of pepsin. An increase in bicarbonate ions and prostaglandins may also confer cytoprotective effects. Calcium carbonate may also be used as a nutritional supplement or to treat hypocalcemia. |
|
| has role | ||
| InChI |
InChI=1S/CH2O3.Ca/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
|
| InChIKey |
InChIKey=VTYYLEPIZMXCLO-UHFFFAOYSA-L |
|
| label |
calcium carbonate |
|
| may interact with |
http://purl.obolibrary.org/obo/dinto_DB00258 http://purl.obolibrary.org/obo/dinto_DB01167 |
|
| prefixIRI |
obo2:CHEBI_3311 |
|
| prefLabel |
calcium carbonate |
|
| SMILES |
[Ca++].[O-]C([O-])=O |
|
| Synonym |
CaCO3 CO3.Ca Kalziumkarbonat carbonate de calcium calcium trioxidocarbonate carbonic acid calcium salt (1:1) CCaO3 kohlensaurer Kalk calcium carbonate carbonato de calcio Calcium carbonate calcium carbonate (1:1) Calciumcarbonat |
|
| xref |
KEGG COMPOUND:C08129 ChEMBL:774490 NIST Chemistry WebBook:471-34-1 CASRN:471-34-1 |
|
| subClassOf |