loading...| Preferred Name | maleic acid | |
| Synonyms |
cis-1,2-ethylenedicarboxylic acid cis-Butenedioic acid cis-ethene-1,2-dioic acid toxilic acid (Z)-butenedioic acid cis-but-2-enedioic acid (Z)-2-butenedioic acid H2male Maleic acid MALEIC ACID (2Z)-but-2-enedioic acid |
|
| Definitions |
A butenedioic acid in which the double bond has cis- (Z)-configuration. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18300 |
|
| alternative label |
cis-1,2-ethylenedicarboxylic acid cis-Butenedioic acid cis-ethene-1,2-dioic acid toxilic acid (Z)-butenedioic acid cis-but-2-enedioic acid (Z)-2-butenedioic acid H2male Maleic acid MALEIC ACID (2Z)-but-2-enedioic acid |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB04299 PMID:9591280 KEGG:C01384 PMID:11386868 Gmelin:49854 Reaxys:605762 PMID:10952545 KNApSAcK:C00007417 Wikipedia:Maleic_acid PDBeChem:MAE CAS:110-16-7 HMDB:HMDB0000176 PMID:22770225 MetaCyc:MALEATE Beilstein:605762 Beilstein:1903639 |
|
| definition |
A butenedioic acid in which the double bond has cis- (Z)-configuration. |
|
| formula |
C4H4O4 |
|
| has exact synonym |
Maleic acid MALEIC ACID (2Z)-but-2-enedioic acid |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
| has_alternative_id |
CHEBI:43836 CHEBI:25119 CHEBI:6653 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
cis-1,2-ethylenedicarboxylic acid cis-Butenedioic acid cis-ethene-1,2-dioic acid toxilic acid (Z)-butenedioic acid cis-but-2-enedioic acid (Z)-2-butenedioic acid H2male |
|
| id |
CHEBI:18300 |
|
| in_subset | ||
| inchi |
InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1- |
|
| inchikey |
VZCYOOQTPOCHFL-UPHRSURJSA-N |
|
| is conjugate acid of | ||
| label |
maleic acid |
|
| mass |
116.07216 |
|
| monoisotopicmass |
116.01096 |
|
| notation |
CHEBI:18300 |
|
| prefLabel |
maleic acid |
|
| smiles |
OC(=O)\C=C/C(O)=O |
|
| subClassOf |