loading...| Preferred Name | prednisolone | |
| Synonyms |
prednisolonum (11beta)-11,17,21-trihydroxypregna-1,4-diene-3,20-dione prednisolone metacortandralone prednisolona 1,4-pregnadiene-3,20-dione-11beta,17alpha,21-triol hydroretrocortine 3,20-dioxo-11beta,17alpha,21-trihydroxy-1,4-pregnadiene 1,4-pregnadiene-11beta,17alpha,21-triol-3,20-dione Delta(1)-hydrocortisone Delta(1)-dehydrocortisol Delta(1)-dehydrohydrocortisone 11beta,17,21-trihydroxypregna-1,4-diene-3,20-dione |
|
| Definitions |
A glucocorticoid that is prednisone in which the oxo group at position 11 has been reduced to the corresponding beta-hydroxy group. It is a drug metabolite of prednisone. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8378 |
|
| alternative_term |
11beta,17,21-trihydroxypregna-1,4-diene-3,20-dione |
|
| charge |
0 |
|
| database_cross_reference |
Drug_Central:2245 CAS:50-24-8 PMID:11294518 KEGG:D00472 HMDB:HMDB0014998 Wikipedia:Prednisolone Reaxys:1354103 DrugBank:DB00860 PMID:24392764 PMID:23625982 KEGG:C07369 Beilstein:1354103 VSDB:1848 |
|
| definition |
A glucocorticoid that is prednisone in which the oxo group at position 11 has been reduced to the corresponding beta-hydroxy group. It is a drug metabolite of prednisone. |
|
| formula |
C21H28O5 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
prednisolonum (11beta)-11,17,21-trihydroxypregna-1,4-diene-3,20-dione prednisolone metacortandralone prednisolona 1,4-pregnadiene-3,20-dione-11beta,17alpha,21-triol hydroretrocortine 3,20-dioxo-11beta,17alpha,21-trihydroxy-1,4-pregnadiene 1,4-pregnadiene-11beta,17alpha,21-triol-3,20-dione Delta(1)-hydrocortisone Delta(1)-dehydrocortisol Delta(1)-dehydrohydrocortisone |
|
| id |
CHEBI:8378 |
|
| imported from | ||
| in_subset | ||
| inchi |
InChI=1S/C21H28O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h5,7,9,14-16,18,22,24,26H,3-4,6,8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1 |
|
| inchikey |
OIGNJSKKLXVSLS-VWUMJDOOSA-N |
|
| label |
prednisolone |
|
| mass |
360.44400 |
|
| monoisotopicmass |
360.19367 |
|
| notation |
CHEBI:8378 |
|
| preferred label |
prednisolone |
|
| prefLabel |
prednisolone |
|
| smiles |
[H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])[C@@H](O)C[C@@]1(C)[C@@]2([H])CC[C@]1(O)C(=O)CO |
|
| textual definition |
A glucocorticoid that is prednisone in which the oxo group at position 11 has been reduced to the corresponding beta-hydroxy group. It is a drug metabolite of prednisone. |
|
| subClassOf |