loading...| Preferred Name | paroxetine | |
| Synonyms |
(3S-trans)-3-((1,3-benzodioxol-5-yloxy)methyl)-4-(4-fluorophenyl)piperidine paroxetinum (-)-(3S,4R)-4-(p-fluorophenyl)-3-((3,4-(methylenedioxy)phenoxy)methyl)piperidine paroxetina (3S,4R)-3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)piperidine Paroxetine |
|
| Definitions |
A benzodioxole that consists of piperidine bearing 1,3-benzodioxol-5-yloxy)methyl and 4-fluorophenyl substituents at positions 3 and 4 respectively; the (3S,4R)-diastereomer. Highly potent and selective 5-HT uptake inhibitor that binds with high affinity to the serotonin transporter (Ki = 0.05 nM). Ki values are 1.1, 350 and 1100 nM for inhibition of [3H]-5-HT, [3H]-l-NA and [3H]-DA uptake respectively. Displays minimal affinity for alpha1-, alpha2- or beta-adrenoceptors, 5-HT2A, 5-HT1A, D2 or H1 receptors at concentrations below 1000 nM, however displays weak affinity for muscarinic ACh receptors (Ki = 42 nM). Antidepressant and anxiolytic in vivo. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7936 |
|
| alternative_term |
(3S,4R)-3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)piperidine Paroxetine |
|
| charge |
0 |
|
| database_cross_reference |
Drug_Central:2068 PMID:14978354 PMID:21739267 PMID:15853570 PMID:17874333 Beilstein:7467879 PMID:12088162 PMID:15241233 PMID:22353759 PMID:17122538 PMID:21452176 PMID:22198456 PMID:17652957 DrugBank:DB00715 PMID:11563413 PMID:22240860 PMID:21908494 PMID:14566200 PMID:15963219 PMID:15199661 PMID:16397315 PMID:15992089 KEGG:C07415 PMID:18273418 PMID:14689334 PMID:15374134 PMID:14566196 PMID:22283559 PMID:21909633 PMID:14521492 Wikipedia:Paroxetine PMID:11281965 PMID:17286545 CAS:61869-08-7 PMID:22263916 PMID:11360029 PMID:15376524 KEGG:D02362 PMID:18345955 PMID:14624192 PMID:16426087 PMID:14619895 PMID:11910269 PMID:19851065 PMID:17612590 PMID:17559097 PMID:14516531 LINCS:LSM-2843 PMID:15845695 PMID:11169163 PMID:11324355 PMID:21939725 PMID:21404089 PMID:18983224 PMID:11565622 PMID:12369443 PMID:12027788 PMID:18808757 PMID:11009210 PMID:15544025 PMID:22212003 PMID:21922171 PMID:17452166 PMID:12906023 PMID:16913391 PMID:16395417 PMID:16822276 PMID:12820211 Reaxys:7467879 PMID:15264994 PMID:12920419 PMID:11513198 PMID:15613191 PMID:11819027 PMID:11893234 PMID:11271409 PMID:12421645 PMID:12818234 PMID:15048901 PMID:19687003 PMID:17162096 PMID:22377745 PMID:16765127 PMID:14673053 PMID:22153922 PMID:17219219 PMID:15903129 |
|
| definition |
A benzodioxole that consists of piperidine bearing 1,3-benzodioxol-5-yloxy)methyl and 4-fluorophenyl substituents at positions 3 and 4 respectively; the (3S,4R)-diastereomer. Highly potent and selective 5-HT uptake inhibitor that binds with high affinity to the serotonin transporter (Ki = 0.05 nM). Ki values are 1.1, 350 and 1100 nM for inhibition of [3H]-5-HT, [3H]-l-NA and [3H]-DA uptake respectively. Displays minimal affinity for alpha1-, alpha2- or beta-adrenoceptors, 5-HT2A, 5-HT1A, D2 or H1 receptors at concentrations below 1000 nM, however displays weak affinity for muscarinic ACh receptors (Ki = 42 nM). Antidepressant and anxiolytic in vivo. |
|
| formula |
C19H20FNO3 |
|
| fromPubMed |
true |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(3S-trans)-3-((1,3-benzodioxol-5-yloxy)methyl)-4-(4-fluorophenyl)piperidine paroxetinum (-)-(3S,4R)-4-(p-fluorophenyl)-3-((3,4-(methylenedioxy)phenoxy)methyl)piperidine paroxetina |
|
| id |
CHEBI:7936 |
|
| imported from | ||
| in_subset | ||
| inchi |
InChI=1S/C19H20FNO3/c20-15-3-1-13(2-4-15)17-7-8-21-10-14(17)11-22-16-5-6-18-19(9-16)24-12-23-18/h1-6,9,14,17,21H,7-8,10-12H2/t14-,17-/m0/s1 |
|
| inchikey |
AHOUBRCZNHFOSL-YOEHRIQHSA-N |
|
| label |
paroxetine |
|
| mass |
329.36540 |
|
| monoisotopicmass |
329.14272 |
|
| notation |
CHEBI:7936 |
|
| oboInOwl:hasDbXRef | ||
| preferred label |
paroxetine |
|
| prefLabel |
paroxetine |
|
| smiles |
[H][C@]1(CCNC[C@H]1COc1ccc2OCOc2c1)c1ccc(F)cc1 |
|
| textual definition |
A benzodioxole that consists of piperidine bearing 1,3-benzodioxol-5-yloxy)methyl and 4-fluorophenyl substituents at positions 3 and 4 respectively; the (3S,4R)-diastereomer. Highly potent and selective 5-HT uptake inhibitor that binds with high affinity to the serotonin transporter (Ki = 0.05 nM). Ki values are 1.1, 350 and 1100 nM for inhibition of [3H]-5-HT, [3H]-l-NA and [3H]-DA uptake respectively. Displays minimal affinity for alpha1-, alpha2- or beta-adrenoceptors, 5-HT2A, 5-HT1A, D2 or H1 receptors at concentrations below 1000 nM, however displays weak affinity for muscarinic ACh receptors (Ki = 42 nM). Antidepressant and anxiolytic in vivo. |
|
| subClassOf |