loading...| Preferred Name |
pimozide |
|
| Synonyms |
Neoperidole Halomonth Opiran Orap pimozida pimozide pimozidum 1-{1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl}-1,3-dihydro-2H-benzimidazol-2-one Pimozide |
|
| Definitions |
A member of the class of benzimidazoles that is 1,3-dihydro-2H-benzimidazol-2-one in which one of the nitrogens is substituted by a piperidin-4-yl group, which in turn is substituted on the nitrogen by a 4,4-bis(p-fluorophenyl)butyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8212 |
|
| alternative term |
Neoperidole Halomonth Opiran Orap pimozida pimozide pimozidum 1-{1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl}-1,3-dihydro-2H-benzimidazol-2-one Pimozide |
|
| charge |
0 |
|
| chemical has protein target | ||
| chemical inhibits protein | ||
| database_cross_reference |
CAS:2062-78-4 DrugBank:DB01100 KEGG:C07566 Beilstein:729089 KEGG:D00560 LINCS:LSM-2001 HMDB:HMDB0015232 Drug_Central:2172 Reaxys:729089 Wikipedia:Pimozide |
|
| definition source |
Reference: PMID: 33403480 |
|
| formula |
C28H29F2N3O |
|
| has exact synonym |
1-{1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl}-1,3-dihydro-2H-benzimidazol-2-one Pimozide pimozide |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_37955 http://purl.obolibrary.org/obo/CHEBI_65190 http://purl.obolibrary.org/obo/CHEBI_66956 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Neoperidole Halomonth Opiran Orap pimozida pimozide pimozidum |
|
| id |
CHEBI:8212 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C28H29F2N3O/c29-22-11-7-20(8-12-22)25(21-9-13-23(30)14-10-21)4-3-17-32-18-15-24(16-19-32)33-27-6-2-1-5-26(27)31-28(33)34/h1-2,5-14,24-25H,3-4,15-19H2,(H,31,34) |
|
| inchikey |
YVUQSNJEYSNKRX-UHFFFAOYSA-N |
|
| label |
pimozide |
|
| mass |
461.54620 |
|
| monoisotopicmass |
461.22787 |
|
| notation |
CHEBI:8212 |
|
| prefLabel |
pimozide |
|
| smiles |
Fc1ccc(cc1)C(CCCN1CCC(CC1)n1c2ccccc2[nH]c1=O)c1ccc(F)cc1 |
|
| textual definition |
A member of the class of benzimidazoles that is 1,3-dihydro-2H-benzimidazol-2-one in which one of the nitrogens is substituted by a piperidin-4-yl group, which in turn is substituted on the nitrogen by a 4,4-bis(p-fluorophenyl)butyl group. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_48585 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.