loading...| Preferred Name |
metformin |
|
| Synonyms |
N(1),N(1)-dimethylbiguanide metforminum 1,1-dimethylbiguanide N,N-dimethyldiguanide dimethylbiguanide dimethyldiguanide N,N-dimethylguanylguanidine N,N-dimethylimidodicarbonimidic diamide N,N-dimethylbiguanide LA 6023 LA-6023 metformin metformina metformine N,N-dimethyltriimidodicarbonic diamide |
|
| Definitions |
A member of the class of guanidines that is biguanide the carrying two methyl substituents at position 1. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6801 |
|
| alternative term |
N(1),N(1)-dimethylbiguanide metforminum 1,1-dimethylbiguanide N,N-dimethyldiguanide dimethylbiguanide dimethyldiguanide N,N-dimethylguanylguanidine N,N-dimethylimidodicarbonimidic diamide N,N-dimethylbiguanide LA 6023 LA-6023 metformin metformina metformine N,N-dimethyltriimidodicarbonic diamide |
|
| charge |
0 |
|
| chemical has protein target | ||
| chemical inhibits protein | ||
| database_cross_reference |
PMID:18608522 PMID:24428821 PMID:17062558 DrugBank:DB00331 PMID:16520442 PMID:11257323 PMID:10900588 PMID:11126815 Drug_Central:1725 PMID:15606381 PMID:16294070 PMID:16941277 PMID:12436333 PMID:12406042 PMID:11544610 Wikipedia:Metformin PMID:15717887 PMID:23077661 PMID:15261814 PDBeChem:MF8 PMID:12086935 CAS:657-24-9 PMID:15650645 PMID:11772907 PMID:10983737 PMID:33191721 LINCS:LSM-4730 PMID:18212742 PMID:12909816 PMID:12630933 HMDB:HMDB0001921 KEGG:C07151 PMID:11012555 KEGG:D04966 PMID:23540700 PMID:10999803 PMID:28919040 FooDB:FDB022739 PMID:11192132 Reaxys:606492 PMID:15932841 PMID:31208831 |
|
| definition source |
Reference: PMID: 24843020 |
|
| formula |
C4H11N5 |
|
| has exact synonym |
N,N-dimethyltriimidodicarbonic diamide |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35526 http://purl.obolibrary.org/obo/CHEBI_176497 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
N(1),N(1)-dimethylbiguanide metforminum 1,1-dimethylbiguanide N,N-dimethyldiguanide dimethylbiguanide dimethyldiguanide N,N-dimethylguanylguanidine N,N-dimethylimidodicarbonimidic diamide N,N-dimethylbiguanide LA 6023 LA-6023 metformin metformina metformine |
|
| has_role | ||
| id |
CHEBI:6801 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C4H11N5/c1-9(2)4(7)8-3(5)6/h1-2H3,(H5,5,6,7,8) |
|
| inchikey |
XZWYZXLIPXDOLR-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
metformin |
|
| mass |
129.167 |
|
| monoisotopicmass |
129.10145 |
|
| notation |
CHEBI:6801 |
|
| prefLabel |
metformin |
|
| smiles |
CN(C)C(=N)NC(N)=N |
|
| textual definition |
A member of the class of guanidines that is biguanide the carrying two methyl substituents at position 1. |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.