loading...| Preferred Name |
Levorphanol |
|
| Synonyms |
Levorphanol levorphanol tartrate levo-dromoran N-Methyl-3-hydroxymorphinan racemorphan aromarone levorphan |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6444 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:C08014 KEGG:D08123 HMDB:HMDB0014992 Drug_Central:1574 CAS:77-07-6 |
|
| formula |
C17H23NO |
|
| has exact synonym |
Levorphanol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
levorphanol tartrate levo-dromoran N-Methyl-3-hydroxymorphinan racemorphan aromarone levorphan |
|
| id |
CHEBI:6444 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C17H23NO/c1-18-9-8-17-7-3-2-4-14(17)16(18)10-12-5-6-13(19)11-15(12)17/h5-6,11,14,16,19H,2-4,7-10H2,1H3/t14-,16+,17+/m0/s1 |
|
| inchikey |
JAQUASYNZVUNQP-USXIJHARSA-N |
|
| label |
Levorphanol |
|
| mass |
257.371 |
|
| monoisotopicmass |
257.17796 |
|
| notation |
CHEBI:6444 |
|
| prefLabel |
Levorphanol |
|
| smiles |
CN1CC[C@]23CCCC[C@H]2[C@H]1Cc1ccc(O)cc31 |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.