loading...| Preferred Name |
clomipramine hydrochloride |
|
| Synonyms |
3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine hydrochloride 3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-aminium chloride 3-chloroimipramine hydrochloride clomipramine HCl clomipramine monohydrochloride chloroimipramine monohydrochloride Anafranil |
|
| Definitions |
A hydrochloride resulting from the reaction of equimolar amounts of clomipramine and hydrogen chloride. One of the more sedating tricyclic antidepressants, it is used for the treatment of depression as well as obsessive-compulsive disorder and phobias. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3755 |
|
| charge |
0 |
|
| chemical effective in vitro against virus | ||
| database_cross_reference |
DrugBank:DB01242 Reaxys:4168494 CAS:17321-77-6 KEGG:D00811 VSDB:1812 |
|
| definition source |
PMID: 24841273 |
|
| formula |
C19H24Cl2N2 |
|
| has exact synonym |
3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine hydrochloride |
|
| has part | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_149553 http://purl.obolibrary.org/obo/CHEBI_48278 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-aminium chloride 3-chloroimipramine hydrochloride clomipramine HCl clomipramine monohydrochloride chloroimipramine monohydrochloride Anafranil |
|
| id |
CHEBI:3755 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C19H23ClN2.ClH/c1-21(2)12-5-13-22-18-7-4-3-6-15(18)8-9-16-10-11-17(20)14-19(16)22;/h3-4,6-7,10-11,14H,5,8-9,12-13H2,1-2H3;1H |
|
| inchikey |
WIMWMKZEIBHDTH-UHFFFAOYSA-N |
|
| label |
clomipramine hydrochloride |
|
| mass |
351.31300 |
|
| monoisotopicmass |
350.13165 |
|
| notation |
CHEBI:3755 |
|
| prefLabel |
clomipramine hydrochloride |
|
| smiles |
Cl.CN(C)CCCN1c2ccccc2CCc2ccc(Cl)cc12 |
|
| textual definition |
A hydrochloride resulting from the reaction of equimolar amounts of clomipramine and hydrogen chloride. One of the more sedating tricyclic antidepressants, it is used for the treatment of depression as well as obsessive-compulsive disorder and phobias. |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.