loading...| Preferred Name |
Chlorpromazine |
|
| Synonyms |
Chlorpromazine 3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethylpropan-1-amine Chlorderazin C17H19ClN2S N-(3-dimethylaminopropyl)-3-chlorophenothiazine chlorpromazinum InChI=1S/C17H19ClN2S/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)21-17-9-8-13(18)12-15(17)20/h3-4,6-9,12H,5,10-11H2,1-2H3 CN(C)CCCN1c2ccccc2Sc2ccc(Cl)cc12 3-(2-chlorophenothiazin-10-yl)-N,N-dimethyl-propan-1-amine 3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethyl-1-propanamine Chlorpromados Chloropromazine clorpromazina chlorpromazine InChIKey=ZPEIMTDSQAKGNT-UHFFFAOYSA-N Aminazine CPZ Contomin Largactil Thorazine |
|
| Definitions |
A substituted phenothiazine in which the ring nitrogen at position 10 is attached to C-3 of an N,N-dimethylpropanamine moiety. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3647 |
|
| capable of inhibiting activity of | ||
| charge |
0 |
|
| chemical binds protein |
http://purl.obolibrary.org/obo/PR_P28335 http://purl.obolibrary.org/obo/PR_P34969 http://purl.obolibrary.org/obo/PR_P50406 |
|
| chemical has protein target as antagonist |
http://purl.obolibrary.org/obo/PR_P14416 http://purl.obolibrary.org/obo/PR_P35348 http://purl.obolibrary.org/obo/PR_P35368 http://purl.obolibrary.org/obo/PR_P08908 http://purl.obolibrary.org/obo/PR_P28223 http://purl.obolibrary.org/obo/PR_P20309 http://purl.obolibrary.org/obo/PR_P21728 |
|
| chemical inhibits in vitro invasion of virus | ||
| chemical inhibits protein |
http://purl.obolibrary.org/obo/PR_P0DP23 http://purl.obolibrary.org/obo/PR_P21918 http://purl.obolibrary.org/obo/PR_P35462 |
|
| database_cross_reference |
KEGG COMPOUND:C06906 NIST Chemistry WebBook:50-53-3 KEGG:D00270 PMID:1650428 PDBeChem:Z80 PMID:20825390 CAS:50-53-3 KEGG:C06906 Reaxys:289793 Drug_Central:621 KEGG DRUG:D00270 Wikipedia:Chlorpromazine KEGG COMPOUND:50-53-3 LINCS:LSM-4017 CiteXplore:1650428 CiteXplore:2427628 PMID:2427628 HMDB:HMDB0014620 PMID:16653219 PMID:7192992 Patent:US2645640 PMID:14354584 PMID:15170372 DrugBank:DB00477 PMID:14404586 Beilstein:289793 ChemIDplus:50-53-3 |
|
| definition source |
PMID: 27344959, PMID: 24841269, PMID: 32387014 |
|
| formula |
C17H19ClN2S |
|
| has exact synonym |
Chlorpromazine 3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethylpropan-1-amine |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_37930 http://purl.obolibrary.org/obo/CHEBI_149553 http://purl.obolibrary.org/obo/CHEBI_50919 http://purl.obolibrary.org/obo/CHEBI_76779 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Chlorderazin C17H19ClN2S N-(3-dimethylaminopropyl)-3-chlorophenothiazine chlorpromazinum InChI=1S/C17H19ClN2S/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)21-17-9-8-13(18)12-15(17)20/h3-4,6-9,12H,5,10-11H2,1-2H3 CN(C)CCCN1c2ccccc2Sc2ccc(Cl)cc12 3-(2-chlorophenothiazin-10-yl)-N,N-dimethyl-propan-1-amine 3-(2-chloro-10H-phenothiazin-10-yl)-N,N-dimethyl-1-propanamine Chlorpromados Chloropromazine clorpromazina chlorpromazine InChIKey=ZPEIMTDSQAKGNT-UHFFFAOYSA-N Aminazine CPZ Contomin Largactil Thorazine |
|
| has_RxCUI |
2403 |
|
| id |
CHEBI:3647 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C17H19ClN2S/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)21-17-9-8-13(18)12-15(17)20/h3-4,6-9,12H,5,10-11H2,1-2H3 |
|
| inchikey |
ZPEIMTDSQAKGNT-UHFFFAOYSA-N |
|
| is_bearer_of | ||
| label |
Chlorpromazine chlorpromazine |
|
| mass |
318.86400 |
|
| monoisotopicmass |
318.09575 |
|
| notation |
CHEBI:3647 |
|
| prefLabel |
Chlorpromazine |
|
| smiles |
CN(C)CCCN1c2ccccc2Sc2ccc(Cl)cc12 |
|
| textual definition |
A substituted phenothiazine in which the ring nitrogen at position 10 is attached to C-3 of an N,N-dimethylpropanamine moiety. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_32876 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.