loading...| Preferred Name |
aspartic acid |
|
| Synonyms |
Aspartic acid aspartic acid 2-aminobutanedioic acid DL-Aminosuccinic acid (R,S)-Aspartic acid DL-Asparagic acid (+-)-Aspartic acid Asp D |
|
| Definitions |
An alpha-amino acid that consists of succinic acid bearing a single alpha-amino substituent |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_22660 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:774618 CAS:617-45-8 Gmelin:185140 KEGG:C16433 Wikipedia:Aspartic_acid PMID:22264337 Beilstein:774618 |
|
| formula |
C4H7NO4 |
|
| has exact synonym |
Aspartic acid aspartic acid |
|
| has part | ||
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-aminobutanedioic acid DL-Aminosuccinic acid (R,S)-Aspartic acid DL-Asparagic acid (+-)-Aspartic acid Asp D |
|
| id |
CHEBI:22660 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9) |
|
| inchikey |
CKLJMWTZIZZHCS-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
aspartic acid |
|
| mass |
133.10272 |
|
| monoisotopicmass |
133.03751 |
|
| notation |
CHEBI:22660 |
|
| prefLabel |
aspartic acid |
|
| smiles |
NC(CC(O)=O)C(O)=O |
|
| textual definition |
An alpha-amino acid that consists of succinic acid bearing a single alpha-amino substituent |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_66873 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.