loading...| Preferred Name |
chloramphenicol |
|
| Synonyms |
Halomycetin chloramphenicolum D-(-)-2,2-dichloro-N-(beta-hydroxy-alpha-(hydroxymethyl)-p-nitrophenylethyl)acetamide cloramfenicol Chloromycetin (-)-chloramphenicol laevomycetinum Oleomycetin chloramphenicol chlornitromycin D-(-)-threo-1-p-nitrophenyl-2-dichloroacetylamino-1,3-propanediol levomicetina levomycetin Amphicol Chloramex Chlorocid Chlorocol Econochlor Fenicol Globenicol Sificetina CHLORAMPHENICOL 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]acetamide Chloramphenicol |
|
| Definitions |
An organochlorine compound that is dichloro-substituted acetamide containing a nitrobenzene ring, an amide bond and two alcohol functions. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17698 |
|
| alternative term |
Halomycetin chloramphenicolum D-(-)-2,2-dichloro-N-(beta-hydroxy-alpha-(hydroxymethyl)-p-nitrophenylethyl)acetamide cloramfenicol Chloromycetin (-)-chloramphenicol laevomycetinum Oleomycetin chloramphenicol chlornitromycin D-(-)-threo-1-p-nitrophenyl-2-dichloroacetylamino-1,3-propanediol levomicetina levomycetin Amphicol Chloramex Chlorocid Chlorocol Econochlor Fenicol Globenicol Sificetina CHLORAMPHENICOL 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]acetamide Chloramphenicol |
|
| charge |
0 |
|
| chemical has protein target | ||
| chemical inhibits protein | ||
| database_cross_reference |
PMID:16897441 PDBeChem:CLM PMID:6653106 CAS:56-75-7 PMID:23395526 PMID:23142491 DrugBank:DB00446 PMID:657786 PMID:12217690 PMID:17692887 PMID:18559535 PMID:23512826 KEGG:C00918 PMID:17963326 LINCS:LSM-5256 PMID:23494278 PMID:18657290 Patent:US2483871 HMDB:HMDB0014589 Patent:GB795131 Wikipedia:Chloramphenicol Patent:GB796901 PMID:23698443 Chemspider:5744 Patent:US2483892 PMID:23317719 Patent:US2483884 MetaCyc:CHLORAMPHENICOL Beilstein:2225532 PMID:7040026 PMID:18794387 Patent:US2839577 PMID:11468347 KEGG:D00104 PMID:16659995 PMID:17217404 Pesticides:chloramphenicol Drug_Central:589 VSDB:1835 |
|
| definition source |
Reference: PMID: 23148581 |
|
| formula |
C11H12Cl2N2O5 |
|
| has exact synonym |
CHLORAMPHENICOL 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]acetamide Chloramphenicol chloramphenicol |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_176497 http://purl.obolibrary.org/obo/CHEBI_33281 http://purl.obolibrary.org/obo/CHEBI_48001 http://purl.obolibrary.org/obo/CHEBI_36047 |
|
| has_alternative_id |
CHEBI:47327 CHEBI:23108 CHEBI:23106 CHEBI:13965 CHEBI:3603 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Halomycetin chloramphenicolum D-(-)-2,2-dichloro-N-(beta-hydroxy-alpha-(hydroxymethyl)-p-nitrophenylethyl)acetamide cloramfenicol Chloromycetin (-)-chloramphenicol laevomycetinum Oleomycetin chloramphenicol chlornitromycin D-(-)-threo-1-p-nitrophenyl-2-dichloroacetylamino-1,3-propanediol levomicetina levomycetin Amphicol Chloramex Chlorocid Chlorocol Econochlor Fenicol Globenicol Sificetina |
|
| has_role | ||
| id |
CHEBI:17698 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C11H12Cl2N2O5/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(4-2-6)15(19)20/h1-4,8-10,16-17H,5H2,(H,14,18)/t8-,9-/m1/s1 |
|
| inchikey |
WIIZWVCIJKGZOK-RKDXNWHRSA-N |
|
| label |
chloramphenicol |
|
| mass |
323.130 |
|
| monoisotopicmass |
322.01233 |
|
| notation |
CHEBI:17698 |
|
| prefLabel |
chloramphenicol |
|
| smiles |
C1=C([C@H]([C@H](NC(C(Cl)Cl)=O)CO)O)C=CC(=C1)[N+]([O-])=O |
|
| textual definition |
An organochlorine compound that is dichloro-substituted acetamide containing a nitrobenzene ring, an amide bond and two alcohol functions. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36683 http://purl.obolibrary.org/obo/CHEBI_37622 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.