loading...| Preferred Name |
carnitine |
|
| Synonyms |
D,L-carnitine 3-hydroxy-4-(trimethylammonio)butanoate carnitine |
|
| Definitions |
An amino-acid betaine that is butanoate substituted with a hydroxy group at position C-3 and a trimethylammonium group at C-4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17126 |
|
| alternative term |
D,L-carnitine 3-hydroxy-4-(trimethylammonio)butanoate carnitine |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:1866665 MetaCyc:DL-CARNITINE Patent:US4315944 Reaxys:1866665 Patent:US4255449 CAS:461-06-3 Wikipedia:Carnitine PMID:23868375 KEGG:C00487 DrugBank:DB02648 PMID:22770225 |
|
| formula |
C7H15NO3 |
|
| has exact synonym |
3-hydroxy-4-(trimethylammonio)butanoate carnitine |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:11817 CHEBI:20047 CHEBI:23038 CHEBI:13947 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
D,L-carnitine |
|
| id |
CHEBI:17126 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C7H15NO3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3 |
|
| inchikey |
PHIQHXFUZVPYII-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
carnitine |
|
| mass |
161.19894 |
|
| monoisotopicmass |
161.10519 |
|
| notation |
CHEBI:17126 |
|
| prefLabel |
carnitine |
|
| smiles |
C[N+](C)(C)CC(O)CC([O-])=O |
|
| textual definition |
An amino-acid betaine that is butanoate substituted with a hydroxy group at position C-3 and a trimethylammonium group at C-4. |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.