loading...| Preferred Name |
progesterone |
|
| Synonyms |
progesterone PROGESTERONE pregn-4-ene-3,20-dione Progesterone Gelbkoerperhormon Delta(4)-pregnene-3,20-dione luteohormone (S)-Progesterone 17alpha-progesterone (S)-4-Pregnene-3,20-dione (S)-Pregn-4-en-3,20-dione 4-Pregnene-3,20-dione Progesteron corpus luteum hormone Agolutin Akrolutin Crinone |
|
| Definitions |
A C21-steroid hormone in which a pregnane skeleton carries oxo substituents at positions 3 and 20 and is unsaturated at C(4)-C(5). As a hormone, it is involved in the female menstrual cycle, pregnancy and embryogenesis of humans and other species. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17026 |
|
| charge |
0 |
|
| chemical binds protein | ||
| chemical has protein target as antagonist | ||
| database_cross_reference |
KEGG:C00410 CAS:57-83-0 PMID:9506942 Wikipedia:Progesterone Beilstein:1915950 Gmelin:708590 Drug_Central:2279 DrugBank:DB00396 MetaCyc:PROGESTERONE Reaxys:1915950 PDBeChem:STR PMID:10438974 KEGG:D00066 HMDB:HMDB0001830 |
|
| definition source |
Reference: PMID: 21084640 |
|
| formula |
C21H30O2 |
|
| has exact synonym |
progesterone PROGESTERONE pregn-4-ene-3,20-dione Progesterone |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_59826 http://purl.obolibrary.org/obo/CHEBI_70709 http://purl.obolibrary.org/obo/CHEBI_77746 |
|
| has_alternative_id |
CHEBI:14896 CHEBI:45786 CHEBI:26269 CHEBI:18798 CHEBI:439 CHEBI:8453 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Gelbkoerperhormon Delta(4)-pregnene-3,20-dione luteohormone (S)-Progesterone 17alpha-progesterone (S)-4-Pregnene-3,20-dione (S)-Pregn-4-en-3,20-dione 4-Pregnene-3,20-dione Progesteron corpus luteum hormone Agolutin Akrolutin Crinone |
|
| has_role | ||
| id |
CHEBI:17026 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C21H30O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12,16-19H,4-11H2,1-3H3/t16-,17+,18-,19-,20-,21+/m0/s1 |
|
| inchikey |
RJKFOVLPORLFTN-LEKSSAKUSA-N |
|
| label |
progesterone |
|
| mass |
314.46170 |
|
| monoisotopicmass |
314.22458 |
|
| notation |
CHEBI:17026 |
|
| prefLabel |
progesterone |
|
| smiles |
[H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](CC[C@@]21[H])C(C)=O |
|
| textual definition |
A C21-steroid hormone in which a pregnane skeleton carries oxo substituents at positions 3 and 20 and is unsaturated at C(4)-C(5). As a hormone, it is involved in the female menstrual cycle, pregnancy and embryogenesis of humans and other species. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36885 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.