loading...| Preferred Name |
L-methionine |
|
| Synonyms |
L-methionine L-Methionine (2S)-2-amino-4-(methylsulfanyl)butanoic acid (S)-2-amino-4-(methylthio)butyric acid (S)-2-amino-4-(methylthio)butanoic acid (S)-methionine L-alpha-amino-gamma-methylmercaptobutyric acid L-(-)-methionine L-Methionin M METHIONINE Met Methionine |
|
| Definitions |
The L-enantiomer of methionine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16643 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:24126240 PMID:22200379 MetaCyc:MET HMDB:HMDB0000696 PMID:5764336 KNApSAcK:C00001379 YMDB:YMDB00318 KEGG:C00073 PMID:24939187 CAS:63-68-3 PMID:21946918 DrugBank:DB00134 PMID:22517898 PMID:16575097 PMID:22448874 ECMDB:ECMDB00696 PDBeChem:MET_LFOH Drug_Central:3347 KEGG:D00019 Reaxys:1722294 Gmelin:26935 PMID:22370952 PMID:21683740 |
|
| formula |
C5H11NO2S |
|
| has exact synonym |
L-methionine L-Methionine |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_74529 http://purl.obolibrary.org/obo/CHEBI_75771 |
|
| has_alternative_id |
CHEBI:21360 CHEBI:13141 CHEBI:43990 CHEBI:6271 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(2S)-2-amino-4-(methylsulfanyl)butanoic acid (S)-2-amino-4-(methylthio)butyric acid (S)-2-amino-4-(methylthio)butanoic acid (S)-methionine L-alpha-amino-gamma-methylmercaptobutyric acid L-(-)-methionine L-Methionin M METHIONINE Met Methionine |
|
| id |
CHEBI:16643 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
|
| inchikey |
FFEARJCKVFRZRR-BYPYZUCNSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-methionine |
|
| mass |
149.21238 |
|
| monoisotopicmass |
149.05105 |
|
| notation |
CHEBI:16643 |
|
| prefLabel |
L-methionine |
|
| smiles |
CSCC[C@H](N)C(O)=O |
|
| textual definition |
The L-enantiomer of methionine. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_83813 http://purl.obolibrary.org/obo/CHEBI_22658 |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.