loading...| Preferred Name | quercetin | |
| Synonyms |
2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-1-benzopyran-4-one 3,5,7,3',4'-PENTAHYDROXYFLAVONE 3,5,7,3',4'-Pentahydroxyflavone 3,3',4',5,7-pentahydroxyflavone xanthaurine sophoretin 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one Quercetin |
|
| Definitions |
A pentahydroxyflavone having the five hydroxy groups placed at the 3-, 3'-, 4'-, 5- and 7-positions. It is one of the most abundant flavonoids in edible vegetables, fruit and wine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16243 |
|
| alternative term |
2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-1-benzopyran-4-one 3,5,7,3',4'-PENTAHYDROXYFLAVONE 3,5,7,3',4'-Pentahydroxyflavone 3,3',4',5,7-pentahydroxyflavone xanthaurine sophoretin 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one Quercetin |
|
| charge |
0 |
|
| chemical has protein target | ||
| chemical inhibits protein | ||
| database_cross_reference |
Patent:US2013012577 PMID:27704720 PMID:23342112 CAS:117-39-5 PMID:18484521 Beilstein:317313 MetaCyc:CPD-520 PMID:27565033 PMID:23359794 Gmelin:579210 DrugBank:DB04216 PMID:27589790 Wikipedia:Quercetin FooDB:FDB011904 PMID:18096136 LIPID_MAPS_instance:LMPK12110004 KNApSAcK:C00004631 PMID:17015250 Drug_Central:3514 PMID:19461927 PMID:22920589 PMID:18579649 HMDB:HMDB0005794 PMID:27591927 KEGG:C00389 PMID:17426744 Reaxys:317313 PMID:16226777 LINCS:LSM-4199 PMID:18785622 PMID:19043800 PMID:18549926 PMID:17135030 PMID:18564899 PDBeChem:QUE Patent:KR20120121684 |
|
| definition source |
Reference: PMID: 26648539 |
|
| formula |
C15H10O7 |
|
| has exact synonym |
2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one Quercetin |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_77020 http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_22586 http://purl.obolibrary.org/obo/CHEBI_176497 http://purl.obolibrary.org/obo/CHEBI_33282 http://purl.obolibrary.org/obo/CHEBI_70770 http://purl.obolibrary.org/obo/CHEBI_37699 http://purl.obolibrary.org/obo/CHEBI_38161 |
|
| has_alternative_id |
CHEBI:45280 CHEBI:14991 CHEBI:11704 CHEBI:26472 CHEBI:8696 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-1-benzopyran-4-one 3,5,7,3',4'-PENTAHYDROXYFLAVONE 3,5,7,3',4'-Pentahydroxyflavone 3,3',4',5,7-pentahydroxyflavone xanthaurine sophoretin |
|
| has_role | ||
| id |
CHEBI:16243 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C15H10O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,16-19,21H |
|
| inchikey |
REFJWTPEDVJJIY-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
quercetin |
|
| mass |
302.238 |
|
| monoisotopicmass |
302.04265 |
|
| notation |
CHEBI:16243 |
|
| prefLabel |
quercetin |
|
| smiles |
OC1=CC(O)=C2C(OC(=C(O)C2=O)C2=CC(O)=C(O)C=C2)=C1 |
|
| textual definition |
A pentahydroxyflavone having the five hydroxy groups placed at the 3-, 3'-, 4'-, 5- and 7-positions. It is one of the most abundant flavonoids in edible vegetables, fruit and wine. |
|
| subClassOf |