Preferred Name | methyl phenyl(piperidin-2-yl)acetate | |
Synonyms |
methyl alpha-phenyl-alpha-(2-piperidyl)acetate methyl alpha-phenyl-alpha-2-piperidinylacetate methyl phenidylacetate alpha-phenyl-2-piperidineacetic acid methyl ester methylphenidan methyl phenyl(piperidin-2-yl)acetate |
|
Definitions |
A amino acid ester that is methyl phenylacetate in which one of the hydrogens alpha to the carbonyl group is replaced by a piperidin-2-yl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_84276 |
|
charge |
0 |
|
definition |
A amino acid ester that is methyl phenylacetate in which one of the hydrogens alpha to the carbonyl group is replaced by a piperidin-2-yl group. |
|
formula |
C14H19NO2 |
|
has_exact_synonym |
methyl phenyl(piperidin-2-yl)acetate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
methyl alpha-phenyl-alpha-(2-piperidyl)acetate methyl alpha-phenyl-alpha-2-piperidinylacetate methyl phenidylacetate alpha-phenyl-2-piperidineacetic acid methyl ester methylphenidan |
|
id |
CHEBI:84276 |
|
in_subset | ||
inchi |
InChI=1S/C14H19NO2/c1-17-14(16)13(11-7-3-2-4-8-11)12-9-5-6-10-15-12/h2-4,7-8,12-13,15H,5-6,9-10H2,1H3 |
|
inchikey |
DUGOZIWVEXMGBE-UHFFFAOYSA-N |
|
label |
methyl phenyl(piperidin-2-yl)acetate |
|
mass |
233.30620 |
|
monoisotopicmass |
233.14158 |
|
notation |
CHEBI:84276 |
|
prefLabel |
methyl phenyl(piperidin-2-yl)acetate |
|
smiles |
COC(=O)C(C1CCCCN1)c1ccccc1 |
|
treeView |
http://purl.obolibrary.org/obo/CHEBI_25248 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_25248 |