Preferred Name |
cannabidiol |
|
Synonyms |
(1'R,2'R)-5'-methyl-4-pentyl-2'-(prop-1-en-2-yl)-1',2',3',4'-tetrahydrobiphenyl-2,6-diol cannabidiol cannabidiolum Delta(1(2))-trans-cannabidiol (-)-trans-cannabidiol (-)-trans-2-p-mentha-1,8-dien-3-yl-5-pentylresorcinol (-)-CBD (-)-cannabidiol |
|
Definitions |
An cannabinoid that is cyclohexene which is substituted by a methyl group at position 1, a 2,6-dihydroxy-4-pentylphenyl group at position 3, and a prop-1-en-2-yl group at position 4. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_69478 |
|
charge |
0 |
|
database_cross_reference |
PDBeChem:P0T CAS:13956-29-1 PMID:31566564 PMID:36868996 PMID:27430346 KEGG:C07578 Drug_Central:5288 Wikipedia:Cannabidiol Patent:US2304669 PMID:27267317 Reaxys:2222023 PMID:26976797 PMID:27506704 PMID:27471947 PMID:27215129 LIPID_MAPS_instance:LMPK13120001 PMID:27157263 DrugBank:DB09061 PMID:27344041 PMID:27374322 PMID:27285147 PMID:26845349 MetaCyc:CPD-7173 PMID:27067870 PMID:32144889 PMID:25703248 KNApSAcK:C00002641 |
|
definition |
An cannabinoid that is cyclohexene which is substituted by a methyl group at position 1, a 2,6-dihydroxy-4-pentylphenyl group at position 3, and a prop-1-en-2-yl group at position 4. |
|
formula |
C21H30O2 |
|
has role | ||
has_alternative_id |
CHEBI:3358 |
|
has_exact_synonym |
(1'R,2'R)-5'-methyl-4-pentyl-2'-(prop-1-en-2-yl)-1',2',3',4'-tetrahydrobiphenyl-2,6-diol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
cannabidiol cannabidiolum Delta(1(2))-trans-cannabidiol (-)-trans-cannabidiol (-)-trans-2-p-mentha-1,8-dien-3-yl-5-pentylresorcinol (-)-CBD (-)-cannabidiol |
|
id |
CHEBI:69478 |
|
in_subset | ||
inchi |
InChI=1S/C21H30O2/c1-5-6-7-8-16-12-19(22)21(20(23)13-16)18-11-15(4)9-10-17(18)14(2)3/h11-13,17-18,22-23H,2,5-10H2,1,3-4H3/t17-,18+/m0/s1 |
|
inchikey |
QHMBSVQNZZTUGM-ZWKOTPCHSA-N |
|
label |
cannabidiol |
|
mass |
314.469 |
|
monoisotopicmass |
314.22458 |
|
notation |
CHEBI:69478 |
|
prefLabel |
cannabidiol |
|
smiles |
[H][C@]1(CCC(C)=C[C@H]1C1=C(O)C=C(CCCCC)C=C1O)C(C)=C |
|
treeView |
http://purl.obolibrary.org/obo/CHEBI_78840 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_78840 |