loading...| Preferred Name | hydrochlorothiazide | |
| Synonyms |
Esidrix (TN) hidroclorotiazida hydrochlorothiazidum hydrochlorothiazide 6-chloro-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide |
|
| Definitions |
A benzothiadiazine that is 3,4-dihydro-2H-1,2,4-benzothiadiazine 1,1-dioxide substituted by a chloro group at position 6 and a sulfonamide at 7. It is diuretic used for the treatment of hypertension and congestive heart failure. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5778 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:625101 DrugBank:DB00999 PMID:24657333 PDBeChem:HCZ PMID:24849193 Wikipedia:Hydrochlorothiazide Drug_Central:1385 PMID:24055851 HMDB:HMDB0001928 LINCS:LSM-5308 KEGG:C07041 KEGG:D00340 CAS:58-93-5 |
|
| definition |
A benzothiadiazine that is 3,4-dihydro-2H-1,2,4-benzothiadiazine 1,1-dioxide substituted by a chloro group at position 6 and a sulfonamide at 7. It is diuretic used for the treatment of hypertension and congestive heart failure. |
|
| formula |
C7H8ClN3O4S2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35498 http://purl.obolibrary.org/obo/CHEBI_35703 |
|
| has_exact_synonym |
6-chloro-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Esidrix (TN) hidroclorotiazida hydrochlorothiazidum hydrochlorothiazide |
|
| id |
CHEBI:5778 |
|
| in_subset | ||
| inchi |
InChI=1S/C7H8ClN3O4S2/c8-4-1-5-7(2-6(4)16(9,12)13)17(14,15)11-3-10-5/h1-2,10-11H,3H2,(H2,9,12,13) |
|
| inchikey |
JZUFKLXOESDKRF-UHFFFAOYSA-N |
|
| label |
hydrochlorothiazide |
|
| mass |
297.73900 |
|
| monoisotopicmass |
296.96448 |
|
| notation |
CHEBI:5778 |
|
| prefLabel |
hydrochlorothiazide |
|
| smiles |
NS(=O)(=O)c1cc2c(NCNS2(=O)=O)cc1Cl |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_35358 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35358 |