loading...| Preferred Name | hexachlorophene | |
| Synonyms |
Almederm Septofen Tersaseptic Hexabalm 2,2'-dihydroxy-3,5,6,3',5',6'-hexachlorodiphenylmethane Nabac Septi-Soft 2,2'-dihydroxy-3,3',5,5',6,6'-hexachlorodiphenylmethane Steral Hexa-Germ Hexafen Gamophen Armohex Surgi-Cen Staphene O Surofene 2,2',3,3',5,5'-hexachloro-6,6'-dihydroxydiphenylmethane 2,2'-methanediylbis(3,4,6-trichlorophenol) bis(3,5,6-trichloro-2-hydroxyphenyl)methane Distodin hexachlorophene Ster-Zac Surgi-cin Acigena Hexide Exofene Phisodan Soy-Dome Steraskin Esaclorofene Germa-medica Phiso-Scrub Septisol Gamophene hexachlorophenum Solu-Heks bis(2-hydroxy-3,5,6-trichlorophenyl)methane Hexascrub Turgex hexaclorofeno 2,2'-methylenebis(3,4,6-trichlorophenol) |
|
| Definitions |
An organochlorine compound that is diphenylmethane in which each of the phenyl groups is substituted by chlorines at positions 2, 3, and 5, and by a hydroxy group at position 6. An antiseptic that is effective against Gram-positive organisms, it is used in soaps and creams for the treatment of various skin disorders. It is also used in agriculture as an acaricide and fungicide, but is not approved for such use within the European Union. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5693 |
|
| charge |
0 |
|
| database_cross_reference |
Patent:US2435593 PMID:397166 KEGG:D00859 PMID:952574 PMID:22313968 Wikipedia:Hexachlorophene PMID:1133685 PDBeChem:H3P PMID:23251633 PPDB:381 Reaxys:2064407 CAS:70-30-4 Patent:US2812365 Patent:US2250480 PMID:894425 Drug_Central:1364 DrugBank:DB00756 KEGG:C08039 LINCS:LSM-6032 HMDB:HMDB0014894 |
|
| definition |
An organochlorine compound that is diphenylmethane in which each of the phenyl groups is substituted by chlorines at positions 2, 3, and 5, and by a hydroxy group at position 6. An antiseptic that is effective against Gram-positive organisms, it is used in soaps and creams for the treatment of various skin disorders. It is also used in agriculture as an acaricide and fungicide, but is not approved for such use within the European Union. |
|
| formula |
C13H6Cl6O2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_86328 http://purl.obolibrary.org/obo/CHEBI_33282 |
|
| has_exact_synonym |
2,2'-methylenebis(3,4,6-trichlorophenol) |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Almederm Septofen Tersaseptic Hexabalm 2,2'-dihydroxy-3,5,6,3',5',6'-hexachlorodiphenylmethane Nabac Septi-Soft 2,2'-dihydroxy-3,3',5,5',6,6'-hexachlorodiphenylmethane Steral Hexa-Germ Hexafen Gamophen Armohex Surgi-Cen Staphene O Surofene 2,2',3,3',5,5'-hexachloro-6,6'-dihydroxydiphenylmethane 2,2'-methanediylbis(3,4,6-trichlorophenol) bis(3,5,6-trichloro-2-hydroxyphenyl)methane Distodin hexachlorophene Ster-Zac Surgi-cin Acigena Hexide Exofene Phisodan Soy-Dome Steraskin Esaclorofene Germa-medica Phiso-Scrub Septisol Gamophene hexachlorophenum Solu-Heks bis(2-hydroxy-3,5,6-trichlorophenyl)methane Hexascrub Turgex hexaclorofeno |
|
| id |
CHEBI:5693 |
|
| in_subset | ||
| inchi |
InChI=1S/C13H6Cl6O2/c14-6-2-8(16)12(20)4(10(6)18)1-5-11(19)7(15)3-9(17)13(5)21/h2-3,20-21H,1H2 |
|
| inchikey |
ACGUYXCXAPNIKK-UHFFFAOYSA-N |
|
| label |
hexachlorophene |
|
| mass |
406.90400 |
|
| monoisotopicmass |
403.84990 |
|
| notation |
CHEBI:5693 |
|
| prefLabel |
hexachlorophene |
|
| smiles |
Oc1c(Cl)cc(Cl)c(Cl)c1Cc1c(O)c(Cl)cc(Cl)c1Cl |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_87039 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_87039 |